ethalfluralin

{{Short description|Weed control herbicide}}

{{Chembox

| Reference =

| ImageFile = Better ethalfluralin.png

| ImageSize = 175px

| PIN = N-Ethyl-α,α,α-trifluoro-N-(2-methylallyl)-2,6-dinitro-p-toluidine

| OtherNames = {{ubl||}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 37761

| EC_number = 259-564-3

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C18827

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 81988

| StdInChI=InChI=1S/C13H14F3N3O4/c1-4-17(7-8(2)3)12-10(18(20)21)5-9(13(14,15)16)6-11(12)19(22)23/h5-6H,2,4,7H2,1,3H3

| StdInChIKey = PTFJIKYUEPWBMS-UHFFFAOYSA-N

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1256703

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 55283-68-6

| PubChem = 41381

| UNII = 51DKA727XQ

| UNNumber = UN3077

| SMILES = CCN(CC(=C)C)C1=C(C=C(C=C1[N+](=O)[O-])C(F)(F)F)[N+](=O)[O-]

}}

|Section2={{Chembox Properties

| C=13|H=14|F=3|N=3|O=4

| Appearance = Yellow to orange crystals

| Odour = Faint amine odour

| Density =

| MeltingPtC = 55

| MeltingPt_notes =

| BoilingPtF =

| BoilingPt_notes =

| Solubility = 0.3 mg/L

| Solvent1 = Acetone

| Solubility1 = >500 g/L

| Solvent2 = Benzene

| Solubility2 = >500 g/L

| Solvent3 = Acetonitrile

| Solubility3 = >500 g/L

| Solvent4 = Xylene

| Solubility4 = >500 g/L

| VaporPressure = 11.5 mPa

}}

|Section3={{Chembox Hazards

| GHS_ref= {{cite web |title=Ethalfluralin |url=https://www.agropages.com/agrodata/Detail-550.htm |website=Grainews |publisher=Agropages |access-date=22 October 2024}}{{cite web |title=Ethalfluralin |url=https://pubchem.ncbi.nlm.nih.gov/compound/41381#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| MainHazards = Skin and eye irritant; toxic to aquatic life

| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|317|319|332|351|400|411}}

| PPhrases = {{P-phrases|203|261|264|264+265|271|272|273|280|302+352|304+340|305+351+338|317|318|321|332+317|333+317|337+317|362+364|391|405|501}}

| LD50 = >5000 mg/kg (oral, rat, or rabbit, dermal)

| LC50 = 0.136 mg/L (trout)

| FlashPtC = 151

| AutoignitionPtF =

}}

}}

Ethalfluralin is a herbicide. It is a preëmergent dinitroaniline developed from trifluralin, used to control annual grasses and broad-leaved weeds. It was synthesised in 1971, first sold in Turkey in 1975, the United States in 1983.{{cite web |last1=Hertfordshire |first1=University of |title=Ethalfluralin (Ref: EL 161) |url=http://sitem.herts.ac.uk/aeru/ppdb/en/Reports/271.htm |website=sitem.herts.ac.uk}} It is used on soybeans, peanuts, potatoes, and as of 2023, is the first conventional herbicide the EPA permits on hemp, as ethalfluralin leaves no residue in the plant.{{cite news |last1=Etter |first1=Kristina |title=Breakthrough for Hemp Growers: Ethalfluralin 1st Conventional Pesticide Tolerance Announced by EPA - Cannabis Tech |url=https://cannabistech.com/articles/ethalfluralin-pesticide-tolerance/ |date=29 August 2023}} Ethalfluralin is not used domestically.

Ethalfluralin did not leach in soil, and the EPA expects it not to contaminate ground water, though it notes the chemically very similar trifluralin has been found in groundwater. Ethalfluralin is very toxic to fish.

Ethalfluralin works by inhibition of microtubule formation, preventing cell division, and is a Group D / Group K1 / Group 3 herbicide (Australian, Global and numeric HRAC respectively). It is applied at approximately 1 kg/Ha.{{cite web |title=Sonalan Product Label |url=https://www.gowanco.com/sites/default/files/2023-04/Sonalan%20HFP%20%2810163-356%29%2001-R0423.pdf}}

In 2024, ethalfluralin was registered in India.{{cite news |title=Saraswati Group launched new herbicide Sonalan HFP (Ethalfluralin) in India |url=https://news.agropages.com/News/NewsDetail---51279.htm |work=Grainews |language=en}}