ethyl dirazepate
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 373155619
| IUPAC_name = ethyl 7-chloro-5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepine-3-carboxylate
| image = Ethyl dirazepate.svg
| width = 220
| tradename =
| legal_status =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 23980-14-5
| PubChem = 208941
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 181035
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106231
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 74FAA305EW
| C=18 | H=14 | Cl=2 | N=2 | O=3
| smiles = CCOC(=O)C1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3Cl
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H14Cl2N2O3/c1-2-25-18(24)16-17(23)21-14-8-7-10(19)9-12(14)15(22-16)11-5-3-4-6-13(11)20/h3-9,16H,2H2,1H3,(H,21,23)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XFVPZJMXRNBHLQ-UHFFFAOYSA-N
}}
Ethyl dirazepateZA Patent 6804601 is a drug which is a benzodiazepine derivative{{cite journal | vauthors = Zaman H, Sampson SJ, Beck AL, Sharma T, Clay FJ, Spyridi S, Zhao S, Gillies D | title = Benzodiazepines for psychosis-induced aggression or agitation | journal = The Cochrane Database of Systematic Reviews | volume = 12 | issue = 12 | pages = CD003079 | date = December 2017 | pmid = 29219171 | pmc = 6486117 | doi = 10.1002/14651858.CD003079.pub4 }} which was developed by Sanofi Winthrop. It has anxiolytic and hypnotic and possibly other characteristic benzodiazepine properties.{{Cite web | url = http://www.psychotropics.dk/moleculeView/default.aspx?ID=1420&Catalogtype=A&ChapterID=1&Thissortorder=17 | title = ethyl dirazepate | access-date = 7 December 2009 | year = 2003 | publisher = psychotropics.dk }}{{Cite journal |title=Drugs of the Future |journal=Thomson Reuters |date=November 1981 |volume=6 |issue=11 |url=http://journals.prous.com/journals/servlet/xmlxsl/pk_journals.xml_toc_pr?p_JournalID=2&p_IssueID=140 }}{{Cite journal |title=LIST OF INTERNATIONAL NON-PROPRIETARY NAMES (INNS), PROVIDED FOR PHARMACEUTICAL SUBSTANCES BY THE WORLD HEALTH ORGANIZATION, WHICH ARE FREE OF DUTY |journal=Official Journal of the European Communities |format=PDF |publisher=eur-lex.europa.eu |date=23 October 2001 |access-date=7 December 2009 |url=http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=OJ:L:2001:279:0767:0876:EN:PDF |url-status=dead |archive-url=https://archive.today/20140627223035/http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=OJ:L:2001:279:0767:0876:EN:PDF |archive-date=27 June 2014 }}