ethylenedinitramine
{{Chembox
| ImageFile = Ethylenedinitramine structure.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = N,{{prime|N}}-Dinitro-1,2-ethanediamine
| OtherNames =Haleite; Dinitroethylene diamine; EDNA
| Section1 = {{Chembox Identifiers
| CASNo = 505-71-5
| UNII = O5GD93K6WK
| PubChem = 10462
| ChemSpiderID = 10030
| SMILES = C(CN[N+](=O)[O-])N[N+](=O)[O-]
| InChI=1S/C2H6N4O4/c7-5(8)3-1-2-4-6(9)10/h3-4H,1-2H2
| InChIKey=QCOXCILKVHKOGO-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| C=2|H=6|N=4|O=4
| Appearance = colorless crystals
| Density = 1,71 g·cm−3
| MeltingPt = 177 °C
| BoilingPt =
| Solubility = slightly soluble
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = 180 °C
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|302}}
| PPhrases = {{P-phrases|264|270|301+312|330|501}}
}}
}}
Ethylenedinitramine (EDNA, also Haleite or Explosive H) is an explosive chemical compound of the nitroamine class, a derivative of the ethylenediamine. EDNA is a powerful explosive, with a detonation velocity of 7,570 m/s, slightly higher than that of other common explosive materials, such as TNT (6,900 m/s) or picric acid (7,350 m/s), but lower than RDX (8,750 m/s) or PETN (8,400 m/s).{{Cite journal | doi = 10.1039/TF9484400677| title = The thermal decomposition of explosives. Part I. Ethylenedinitramine and tetryl| journal = Transactions of the Faraday Society| volume = 44| pages = 677| year = 1948| last1 = Robertson| first1 = A. J. B}}
Ednatol is a high explosive comprising about 58% ethylenedinitramine and 42% TNT.