ethylone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447557117

| IUPAC_name = (RS)-1-(1,3-benzodioxol-5-yl)-2-(ethylamino)propan-1-one

| image = Bk-MDEA.svg

| width = 200px

| chirality = Racemic mixture

| tradename =

| pregnancy_category = N (US)

| legal_AU =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_CA =

| legal_DE = Anlage I

| legal_NZ =

| legal_UK = Class B

| legal_US =

| legal_UN = P II

| legal_UN_comment = {{Cite web |title=Substance Details Ethylone |url=https://www.unodc.org/LSS/Substance/Details/2d91de8d-13b7-4c69-9a1b-b1b379c4223e |access-date=2024-01-22}}

| legal_EU =

| routes_of_administration = Oral, nasal, IV

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 1112937-64-0

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = L91C78FW96

| ATC_prefix =

| ATC_suffix =

| PubChem = 57252245

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C22709

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 21106271

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H15NO3/c1-3-13-8(2)12(14)9-4-5-10-11(6-9)16-7-15-10/h4-6,8,13H,3,7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MJEMIOXXNCZZFK-UHFFFAOYSA-N

| C=12 | H=15 | N=1 | O=3

| smiles = CC(NCC)C(=O)c1ccc2OCOc2c1

}}

Ethylone, also known as 3,4-methylenedioxy-N-ethylcathinone (MDEC, βk-MDEA), is a recreational designer drug of the phenethylamine, amphetamine, and cathinone chemical classes. It is the β-keto analogue of MDEA ("Eve"). Ethylone has only a short history of human use and is reported to be less potent than its relative methylone.{{citation needed|date=May 2015}} In the United States, it began to be found in cathinone products in late 2011.{{cite journal | vauthors = Lee D, Chronister CW, Hoyer J, Goldberger BA | title = Ethylone-Related Deaths: Toxicological Findings | journal = Journal of Analytical Toxicology | volume = 39 | issue = 7 | pages = 567–71 | date = September 2015 | pmid = 26025164 | doi = 10.1093/jat/bkv053 | doi-access = free }}

Very little data exists about the pharmacological properties, metabolism, and toxicity of ethylone, and although several ethylone-related deaths have been reported, the cause of death was not due to ingestion of ethylone.