etofamide

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 444548303

| IUPAC_name = 2,2-dichloro-N-(2-ethoxyethyl)-N- [4-(4-nitrophenoxy)benzyl]acetamide

| image = Etofamide.svg

| tradename =

| Drugs.com = {{drugs.com|international|etofamide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 25287-60-9

| ATC_prefix = P01

| ATC_suffix = AC03

| ATC_supplemental =

| PubChem = 65718

| ChEMBL = 1788393

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 03F36JH21U

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07355

| ChemSpiderID = 59142

| C=19 | H=20 | Cl=2 | N=2 | O=5

| smiles = CCOCCN(CC1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-])C(=O)C(Cl)Cl

| StdInChI = 1S/C19H20Cl2N2O5/c1-2-27-12-11-22(19(24)18(20)21)13-14-3-7-16(8-4-14)28-17-9-5-15(6-10-17)23(25)26/h3-10,18H,2,11-13H2,1H3

| StdInChIKey = QTRALMGDQMIVFF-UHFFFAOYSA-N

}}

Etofamide (INN, also known as eticlordifene) is an antiprotozoal drug used in the treatment of amoebiasis.

Its effect against Giardia lamblia has been described as modest.{{cite journal | vauthors = Cedillo-Rivera R, Muñoz O | title = In-vitro susceptibility of Giardia lamblia to albendazole, mebendazole and other chemotherapeutic agents | journal = Journal of Medical Microbiology | volume = 37 | issue = 3 | pages = 221–4 | date = September 1992 | pmid = 1518040 | doi = 10.1099/00222615-37-3-221 | doi-access = free }}