etofenamate

{{Short description|NSAID analgesic medication}}

{{Drugbox

| verifiedrevid = 447984387

| IUPAC_name = 2-(2-hydroxyethoxy)ethyl 2-[ [3-(trifluoromethyl)phenyl]amino]benzoate

| image = Etofenamate.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|etofenamate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = OTC

| routes_of_administration = Topical (cream, gel, spray)

| bioavailability =

| protein_bound = 98–99%

| metabolism =

| metabolites = Flufenamic acid, hydroxyl derivatives

| elimination_half-life =

| excretion = 35% renal, mostly biliary

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 30544-47-9

| ATC_prefix = M02

| ATC_suffix = AA06

| PubChem = 35375

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08984

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 32560

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KZF0XM66JC

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04102

| C=18 | H=18 | F=3 | N=1 | O=4

| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)OCCOCCO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H18F3NO4/c19-18(20,21)13-4-3-5-14(12-13)22-16-7-2-1-6-15(16)17(24)26-11-10-25-9-8-23/h1-7,12,22-23H,8-11H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XILVEPYQJIOVNB-UHFFFAOYSA-N

}}

Etofenamate is a nonsteroidal anti-inflammatory drug (NSAID) used for the treatment of joint and muscular pain.{{cite journal | vauthors = Chlud K | title = [Use of topical non-steroidal anti-inflammatory drugs in aggravated and decompensated arthroses] | language = German | journal = Wiener Medizinische Wochenschrift | volume = 149 | issue = 19–20 | pages = 546–7 | year = 1999 | pmid = 10637963 }} It is available for topical application as a cream, a gel or as a spray.

Etofenamate is acutely toxic if swallowed; it is also very toxic to aquatic life, with long lasting effects.{{cite web | work = PubChem | url = https://pubchem.ncbi.nlm.nih.gov/compound/35375 | title = Etofenamate }}{{Unreliable medical source|date=February 2019}}