etoxeridine
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 447992218
| IUPAC_name = Ethyl 1-[2-(2-hydroxyethoxy)ethyl]-4-phenylpiperidine-4-carboxylate
| image = Etoxeridine.svg
| image_class = skin-invert-image
| width = 160
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU = S9
| legal_BR = A1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_CA = Schedule I
| legal_UK = Class A
| legal_US = Schedule I
| legal_DE = Anlage I
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 469-82-9
| ChEMBL = 2104254
| ATC_prefix = none
| ATC_suffix =
| PubChem = 61122
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01505
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 55070
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = RHW35E1G7E
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D12680
| C=18 | H=27 | N=1 | O=4
| smiles = C1(CCN(CC1)CCOCCO)(C(=O)OCC)C2=CC=CC=C2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H27NO4/c1-2-23-17(21)18(16-6-4-3-5-7-16)8-10-19(11-9-18)12-14-22-15-13-20/h3-7,20H,2,8-15H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KJTKYGFGPQSRRA-UHFFFAOYSA-N
| synonyms = Etoxeridine, Carbetidine, Atenos
}}
Etoxeridine (Carbetidine, Atenos) is a 4-phenylpiperidine derivative that is related to the clinically used opioid analgesic drug pethidine (meperidine).
Etoxeridine was developed in the 1950s{{cite patent | country = BE | number = 558883}} and investigated for use in surgical anesthesia, however it was never commercialized and is not currently used in medicine.{{Cite journal | vauthors = Merlevede E, Levis S | title = Pharmacological study of carbetidine, a new synthetic analgesic | language = French | journal = Archives Internationales de Pharmacodynamie et de Thérapie | date = 1958 | volume = 115 | issue = 1–2 | pages = 213–232| pmid = 13545901 }}{{Cite journal | author = Sironi PG | title = Brief note on a new synthetic analgesic: carbetidine hydrochloride | language = Italian | journal = Minerva Anestesiologica | date = 1959 | volume = 25 | issue = 6 | pages = 251–254 | pmid = 13674097 }}{{cite journal | vauthors = Crawford JS, Foldes FF | title = Studies on the respiratory and circulatory effects of carbetidine HCI used for supplementation of thiopentone sodium-nitrous oxide-oxygen anaesthesia | journal = British Journal of Anaesthesia | volume = 31 | issue = 8 | pages = 348–51 | date = August 1959 | pmid = 13812715 | doi = 10.1093/bja/31.8.348 | doi-access = free }} As with other opioids which were not in clinical use during the drafting of the Controlled Substances Act, it is categorized as a Schedule I narcotic.