etozolin

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = Ethyl (2Z)-(3-methyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)ethanoate

| image = Etozolin structure.svg

| tradename = Diulozin, Elkapin, Etopinil

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = ?

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 73-09-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UEO8UW9V1Z

| ATC_prefix = C03

| ATC_suffix = CX01

| PubChem = 5743585

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08982

| ChemSpiderID = 4675409

| synonyms = Etozoline

| C=13 | H=20 | N=2 | O=3 | S=1

| smiles = CCOC(=O)/C=C1/N(C)C(=O)C(S1)N2CCCCC2

}}

Etozolin (Diulozin, Elkapin, Etopinil) is a loop diuretic used in Europe.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 }}{{cite journal | vauthors = Lant A | title = Diuretic drugs. Progress in clinical pharmacology | journal = Drugs | volume = 31 Suppl 4 | pages = 40–55 | year = 1986 | pmid = 3525089 | doi = 10.2165/00003495-198600314-00006 | s2cid = 24593808 }} It is believed to be discontinued.{{cite web |title=Etozolin |url=https://drugs.ncats.io/drug/UEO8UW9V1Z |website=Inxight: Drugs |publisher=NIH NCATS |access-date=10 March 2021}}