eugenodilol

{{short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = 1-(4-Allyl-2-methoxyphenoxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}-2-propanol

| image = Eugenodilol.svg

| width = 250px

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 242796-68-5

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 9930145

| ChemSpiderID = 8105776

| DrugBank =

| C=22 | H=29 | N=1 | O=5

| SMILES = O(c1ccc(cc1OC)C\C=C)CC(O)CNCCOc2ccccc2OC

| StdInChI = 1S/C22H29NO5/c1-4-7-17-10-11-21(22(14-17)26-3)28-16-18(24)15-23-12-13-27-20-9-6-5-8-19(20)25-2/h4-6,8-11,14,18,23-24H,1,7,12-13,15-16H2,2-3H3

| StdInChIKey = NWFVEPJYORHHOG-UHFFFAOYSA-N

}}

Eugenodilol is an alpha-1 blocker and beta blocker with weak β₂-adrenergic receptor agonist activity derived from eugenol.{{cite journal | journal = J Cardiovasc Pharmacol | date = Jul 1999 | volume = 34 | issue = 1 | pages = 10–20 | title = Eugenodilol: a third-generation beta-adrenoceptor blocker, derived from eugenol, with alpha-adrenoceptor blocking and beta2-adrenoceptor agonist-associated vasorelaxant activities |vauthors=Huang YC, Wu BN, Lin YT, Chen SJ, Chiu CC, Cheng CJ, Chen IJ | pmid= 10413061 | doi=10.1097/00005344-199907000-00003| doi-access = free }}