famoxadone

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 459444593

| ImageFile = Famoxadone.svg

| ImageSize = 200px

| IUPACName = (RS)-5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione

| OtherNames = Famoxate; FMX

| Section1 = {{Chembox Identifiers

| CASNo = 131807-57-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V1C07OR6II

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 59340

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1812200

| PubChem = 213032

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 184727

| SMILES = O=C2OC(C(=O)N2Nc1ccccc1)(c4ccc(Oc3ccccc3)cc4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H18N2O4/c1-22(16-12-14-19(15-13-16)27-18-10-6-3-7-11-18)20(25)24(21(26)28-22)23-17-8-4-2-5-9-17/h2-15,23H,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PCCSBWNGDMYFCW-UHFFFAOYSA-N

| InChI = 1/C22H18N2O4/c1-22(16-12-14-19(15-13-16)27-18-10-6-3-7-11-18)20(25)24(21(26)28-22)23-17-8-4-2-5-9-17/h2-15,23H,1H3

| InChIKey = PCCSBWNGDMYFCW-UHFFFAOYAG

}}

| Section2 = {{Chembox Properties

| C=22|H=18|N=2|O=4

| Appearance =

| Density =

| MeltingPt = 140.3-141.8 °C

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Famoxadone is a fungicide to protect agricultural products against various fungal diseases on fruiting vegetables, tomatoes, potatoes, curcurbits, lettuce and grapes.[http://www.epa.gov/opprd001/factsheets/famoxadone.pdf Famoxadone Pesticide Fact Sheet], United States Environmental Protection Agency It is used in combination with cymoxanil.{{cite web | url=http://site.extension.uga.edu/viticulture/files/2021/02/Pathology-Downy-Powdery-Mildew-Presentation-2021.pdf | title=Fungicide resistance management for powdery and downy mildews | author=Phillip Brannen}} Famoxadone is a QoI, albeit with a chemistry different from most Q{{sub|o}}Is. (It is an oxazolidine-dione while most are strobilurins.){{cite web | url=http://www.frac.info/docs/default-source/publications/frac-code-list/frac-code-list-2021--final.pdf | title=FRAC Code List ©*2021: Fungal control agents sorted by cross resistance pattern and mode of action (including coding for FRAC Groups on product labels) | date=March 2021 | author=FRAC (Fungicide Resistance Action Committee) | pages=1–17 | access-date=2021-07-12 | archive-date=2021-11-05 | archive-url=https://web.archive.org/web/20211105005300/https://www.frac.info/docs/default-source/publications/frac-code-list/frac-code-list-2021--final.pdf | url-status=dead }} It is commonly used against Plasmopara viticola, Alternaria solani,{{cite book | editor=Ishii H., Hollomon D. | last=Schepers | first=Huub T. A. M. | last2=Cooke | first2=Louise R. | title=Fungicide Resistance in Plant Pathogens | chapter=Potato Pathogens in Northern and Western Europe | publisher=Springer Japan | publication-place=Tokyo | year=2015 | isbn=978-4-431-55641-1 | pages=355–378}} Phytophthora infestans, and Septoria nodorum.{{cite journal | last=Knight | first=S. C. | last2=Anthony | first2=V. M. | last3=Brady | first3=A. M. | last4=Greenland | first4=A. J. | last5=Heaney | first5=S. P. | last6=Murray | first6=D. C. | last7=Powell | first7=K. A. | last8=Schulz | first8=M. A. | last9=Spinks | first9=C. A. | last10=Worthington | first10=P. A. | last11=Youle | first11=D. | title=Rationale and Perspectives on the Development of Fungicides | journal=Annual Review of Phytopathology | publisher=Annual Reviews | volume=35 | issue=1 | year=1997 | issn=0066-4286 | doi=10.1146/annurev.phyto.35.1.349 | pages=349–372}}