farglitazar

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458623142

| IUPAC_name = N-(o-Benzoylphenyl)-O-[2-(5-methyl- 2-phenyl-4-oxazolyl)ethyl]-L-tyrosine

| image = Farglitazar.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = N/A

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Development discontinued

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 196808-45-4

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 170364

| KEGG = D04132

| IUPHAR_ligand = 2672

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3433GY7132

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 107367

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 148961

| chemical_formula =

| C=34 | H=30 | N=2 | O=5

| smiles = O=C(c1ccccc1)c2ccccc2N[C@H](C(=O)O)Cc5ccc(OCCc3nc(oc3C)c4ccccc4)cc5

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C34H30N2O5/c1-23-29(36-33(41-23)26-12-6-3-7-13-26)20-21-40-27-18-16-24(17-19-27)22-31(34(38)39)35-30-15-9-8-14-28(30)32(37)25-10-4-2-5-11-25/h2-19,31,35H,20-22H2,1H3,(H,38,39)/t31-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZZCHHVUQYRMYLW-HKBQPEDESA-N

}}

Farglitazar is a peroxisome proliferator-activated receptor agonist which was formerly under development by GlaxoSmithKline, but has never been marketed. It progressed to phase II clinical trials for the treatment of hepatic fibrosis, but failed to show efficacy.{{cite journal | vauthors = McHutchison J, Goodman Z, Patel K, Makhlouf H, Rodriguez-Torres M, Shiffman M, Rockey D, Husa P, Chuang WL, Levine R, Jonas M, Theodore D, Brigandi R, Webster A, Schultz M, Watson H, Stancil B, Gardner S | display-authors = 6 | title = Farglitazar lacks antifibrotic activity in patients with chronic hepatitis C infection | journal = Gastroenterology | volume = 138 | issue = 4 | pages = 1365–73, 1373.e1-2 | date = April 2010 | pmid = 20004661 | doi = 10.1053/j.gastro.2009.12.003 }} After reaching phase III for type 2 diabetes, further development was discontinued.{{cite web | url = https://adisinsight.springer.com/drugs/800008802 | title = Farglitazar | work = Adis Insight | publisher = Springer Nature Switzerland AG }}{{cite web | url = https://www.pharmacodia.com/yaodu/html/v1/chemicals/ba48bccfc0d72c73228d80154ec7bf39.html | title = Farglitazar | publisher = pharmacodia.com }}