feclemine

{{Short description|Spasmolytic drug}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Feclemine

| image = Feclemine.svg

| width = 150

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 3590-16-7

| CAS_supplemental =

| PubChem = 3030835

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 2295996

| DTXSID = DTXSID80863211

| UNII = 5P7U986QGO

| KEGG =

| ChEBI = 135518

| ChEMBL = 2106137

| NIAID_ChemDB =

| PDB_ligand = PD072576

| synonyms = {{ubl|Fenetamin|Giacosil|Licabile|Licaran|Phenecyclamine|Phenetamine|Spasmexan|UCB-1545}}

| IUPAC_name = 2-[Cyclohexyl(phenyl)methyl]-N,N,N',N'-tetraethylpropane-1,3-diamine

| C=24 | H=42 | N=2

| SMILES = CCN(CC)CC(CN(CC)CC)C(C1CCCCC1)C2=CC=CC=C2

| StdInChI = 1S/C24H42N2/c1-5-25(6-2)19-23(20-26(7-3)8-4)24(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9,11-12,15-16,22-24H,5-8,10,13-14,17-20H2,1-4H3

| StdInChIKey = QDMORDTWFMWOFA-UHFFFAOYSA-N

}}

Feclemine (phenetamine) is a spasmolytic drug.{{cite journal | vauthors = Crema A, Benzi G, Frigo GM, Berté F | title = Method for evaluating spasmolytic activity of drugs on the bile duct | journal = The Journal of Pharmacy and Pharmacology | volume = 17 | issue = 7 | pages = 405–408 | date = July 1965 | pmid = 4379262 | doi = 10.1111/j.2042-7158.1965.tb07695.x }}

Synthesis

The chemical synthesis is discussed:{{cite journal | vauthors = Morren HG, Denayer R, Trolin S, Strubbe H, Linz R, Dony G, Collard R | title = Antispasmodics with musculotropic action derived from 1,3-bis(dialkylamino)propane | journal = Industrie Chimique Belge | volume = 20 | pages = 733–745 | date = 1955 }}

File:Feclemine synthesis.svg

Sodamide is used to alkylate cyclohexylphenylacetonitrile [3893-23-0] (1) (also used for drofenine) with 2-chloro-N,N,N',N'-tetraethylpropane-1,3-diamine [3492-54-4] (HCl: [94465-65-3]) to give (2). Some rearrangement is possible to give a mixture of regioisomers. Sodamide catalyzed cleavage of the nitrile group in a separate step then completes the synthesis of feclemine (3).

File:Feclemine sidechain synthesis.svg

Precursor: Alcohol:{{cite journal | vauthors = Schütz S, Kurz J, Plümpe H, Bock M, Otten H | title = [Basically alkylated imides of naphthalene-1,4,5,8-tetracarboxylic acid and their chemotherapeutic effects] | journal = Arzneimittel-Forschung | volume = 21 | issue = 6 | pages = 739–763 | date = June 1971 | pmid = 4998088 | language = German }}

References