fedrilate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443785106

| IUPAC_name = 4-morpholin-4-ylbutan-2-yl 4-phenyloxane-4-carboxylate

| image = fedrilate.png

| tradename = Tussefan

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 23271-74-1

| ATC_prefix = R05

| ATC_suffix = DB14

| PubChem = 31796

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 2104591

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 29485

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NT86R8M7J5

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07389

| C=20 | H=29 | N=1 | O=4

| smiles = O=C(OC(CCN1CCOCC1)C)C3(c2ccccc2)CCOCC3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H29NO4/c1-17(7-10-21-11-15-24-16-12-21)25-19(22)20(8-13-23-14-9-20)18-5-3-2-4-6-18/h2-6,17H,7-16H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RDEOYUSTRWNWLX-UHFFFAOYSA-N

}}

Fedrilate is a centrally acting cough suppressant. It was patented as a mucolytic by UCB in 1971, but was never brought to market in the US.{{cite patent |country=US |number=3567835 |title=Mucolytic salts, compositions and process for treating mucus |inventor=Henri Morren |gdate=March 2, 1971 |status=patent}} In the Netherlands, it has been marketed as Tussefan and in combination with guaifenesin as Tussefan expectorans.{{cite book |title=Pharmacotherapeutisch Vademecum |lang=nl |location=Bussum |publisher=Romen |vauthors=Kok J, Oosterveld WJ, Sibilo SR |date=1979 |isbn=90-228-8006-0}}