felbinac

{{Short description|Topical NSAID medication}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443752362

| IUPAC_name = biphenyl-4-ylacetic acid

| image = Felbinac.svg

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|felbinac}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK = P

| legal_US =

| legal_status =

| routes_of_administration = Topical

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 5728-52-9

| ATC_prefix = M02

| ATC_suffix = AA08

| PubChem = 3332

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB07477

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3215

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 94WNJ5U8L7

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01675

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 31597

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 413965

| C=14 | H=12 | O=2

| smiles = O=C(O)Cc1ccc(cc1)c2ccccc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QRZAKQDHEVVFRX-UHFFFAOYSA-N

}}

Felbinac (INN, or biphenylylacetic acid) is a topical medicine,The Merck Index, 12th Edition. 3989 belonging to the family of medicines known as nonsteroidal anti-inflammatory drugs (NSAIDs) of the arylacetic acid (not arylpropionic acid) class, which is used to treat muscle inflammation and arthritis.Description of Felbinac on Tiscali [https://web.archive.org/web/20060929171650/http://www.tiscali.co.uk/lifestyle/healthfitness/health_advice/netdoctor/archive/100003440.html] It is an active metabolite of fenbufen.{{cite journal |vauthors=Kohler C, Tolman E, Wooding W, Ellenbogen L | title=A review of the effects of fenbufen and a metabolite, biphenylacetic acid, on platelet biochemistry and function | journal=Arzneimittelforschung | volume=30 | issue=4A | pages=702–707 | year=1980 | pmid=6254545}}