felbinac
{{Short description|Topical NSAID medication}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443752362
| IUPAC_name = biphenyl-4-ylacetic acid
| image = Felbinac.svg
| image_class = skin-invert-image
| tradename =
| Drugs.com = {{drugs.com|international|felbinac}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK = P
| legal_US =
| legal_status =
| routes_of_administration = Topical
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 5728-52-9
| ATC_prefix = M02
| ATC_suffix = AA08
| PubChem = 3332
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB07477
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3215
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 94WNJ5U8L7
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01675
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31597
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 413965
| C=14 | H=12 | O=2
| smiles = O=C(O)Cc1ccc(cc1)c2ccccc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QRZAKQDHEVVFRX-UHFFFAOYSA-N
}}
Felbinac (INN, or biphenylylacetic acid) is a topical medicine,The Merck Index, 12th Edition. 3989 belonging to the family of medicines known as nonsteroidal anti-inflammatory drugs (NSAIDs) of the arylacetic acid (not arylpropionic acid) class, which is used to treat muscle inflammation and arthritis.Description of Felbinac on Tiscali [https://web.archive.org/web/20060929171650/http://www.tiscali.co.uk/lifestyle/healthfitness/health_advice/netdoctor/archive/100003440.html] It is an active metabolite of fenbufen.{{cite journal |vauthors=Kohler C, Tolman E, Wooding W, Ellenbogen L | title=A review of the effects of fenbufen and a metabolite, biphenylacetic acid, on platelet biochemistry and function | journal=Arzneimittelforschung | volume=30 | issue=4A | pages=702–707 | year=1980 | pmid=6254545}}
Related compounds
The α-methyl acid of felbinac is called biprofen and is used to prepare bifepramide. The α-ethyl acid is called xenbucin which is used to make xenthiorate.
See also
References
{{Reflist}}
{{NSAIDs}}
{{Topical products for joint and muscular pain}}
{{Prostanoidergics}}
Category:Nonsteroidal anti-inflammatory drugs
{{musculoskeletal-drug-stub}}