fenamidone
{{Distinguish|Amidone}}
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 459444495
| ImageFile = Fenamidone.svg
| ImageSize =
| PIN = (5S)-3-Anilino-5-methyl-2-(methylsulfanyl)-5-phenyl-3,5-dihydro-4H-imidazol-4-one
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 161326-34-7
| CASNo_Ref = {{cascite|changed|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DN24MG2Z5E
| PubChem = 10403199
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8578637
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 83258
| SMILES = O=C2N(Nc1ccccc1)C(\SC)=N/[C@]2(c3ccccc3)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H17N3OS/c1-17(13-9-5-3-6-10-13)15(21)20(16(18-17)22-2)19-14-11-7-4-8-12-14/h3-12,19H,1-2H3/t17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LMVPQMGRYSRMIW-KRWDZBQOSA-N
| InChI = 1/C17H17N3OS/c1-17(13-9-5-3-6-10-13)15(21)20(16(18-17)22-2)19-14-11-7-4-8-12-14/h3-12,19H,1-2H3/t17-/m0/s1
| InChIKey = LMVPQMGRYSRMIW-KRWDZBQOBL
}}
| Section2 = {{Chembox Properties
| C=17|H=17|N=3|O=1|S=1
| Appearance =
| Density =
| MeltingPt = 136-138 °C
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Fenamidone is a foliar fungicide used on grapes, ornamentals, potatoes, tobacco, and vegetables such as tomatoes.{{cite journal|title=Determination of famoxadone, fenamidone, fenhexamid and iprodione residues in greenhouse tomatoes|journal=Pest Management Science|volume=68|issue=4|pages=543–547|doi=10.1002/ps.2287|pmid=22102420|year=2012|last1=Angioni|first1=Alberto|last2=Porcu|first2=Luciano|last3=Dedola|first3=Fabrizio}} It exerts its fungicidal effects by acting as a Qo inhibitor.{{cite journal | doi = 10.1002/ps.1146 | title = Effect of dose rate and mixtures of fungicides on selection for QoI resistance in populations of Plasmopara viticola | date = 2006 | last1 = Genet | first1 = Jean-Luc | last2 = Jaworska | first2 = Grazyna | last3 = Deparis | first3 = Francine | journal = Pest Management Science | volume = 62 | issue = 2 | pages = 188–194 | pmid = 16411165 }}