fencamine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1,3,7-trimethyl-8-({2-[methyl(1-phenylpropan-2-yl)amino]ethyl}amino)-3,7-dihydro-1H-purine-2,6-dione

| image = Fencamine.png

| image_class = skin-invert-image

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 28947-50-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3AO7AC8C6K

| ATC_prefix = none

| ATC_suffix =

| PubChem = 115374

| ChemSpiderID = 103208

| C=20 | H=28 | N=6 | O=2

| smiles = O=C2N(c1nc(n(c1C(=O)N2C)C)NCCN(C(C)Cc3ccccc3)C)C

}}

Fencamine (Altimina, Sicoclor) is a psychostimulant drug of the amphetamine class. It is closely related to fenethylline.{{cite journal | vauthors = Cody JT | title = Precursor medications as a source of methamphetamine and/or amphetamine positive drug testing results | journal = Journal of Occupational and Environmental Medicine | volume = 44 | issue = 5 | pages = 435–50 | date = May 2002 | pmid = 12024689 | doi = 10.1097/00043764-200205000-00012 | s2cid = 44614179 }}