fenharmane
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = Phenharmane.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class = Sedative; Tranquilizer; Reserpine-like agent
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 3851-30-7
| CAS_supplemental =
| PubChem = 71167
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 64307
| UNII = 9E96TNX6EZ
| KEGG =
| ChEBI =
| ChEMBL = 323357
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = Fenharman; Phenharman; Phenharmane; Fenoharman; Fenoharmane; Phenoharman; Phenoharmane; 1-Benzyl-1,2,3,4-tetrahydronorharmane; Benzyltetrahydronorharman
| IUPAC_name = 1-benzyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole
| C=18 | H=18 | N=2
| SMILES = C1CNC(C2=C1C3=CC=CC=C3N2)CC4=CC=CC=C4
| StdInChI = 1S/C18H18N2/c1-2-6-13(7-3-1)12-17-18-15(10-11-19-17)14-8-4-5-9-16(14)20-18/h1-9,17,19-20H,10-12H2
| StdInChIKey = LHVNPTMRAQQPID-UHFFFAOYSA-N
}}
Fenharmane ({{Abbrlink|INN|International Nonproprietary Name}}), also known as 1-benzyl-1,2,3,4-tetrahydronorharmane, is a sedative and tranquilizer of the β-carboline family.{{cite book | vauthors = Elks J | title = The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | pages = 144–145 | date = 14 November 2014 | publisher = Springer | isbn = 978-1-4757-2085-3 | url = https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA144 }}{{cite journal | vauthors = Švestka J | title = S31.03 The history of czech psychopharmacology and psychopharmacotherapy of affective and schizophrenic disorders | journal = European Psychiatry | volume = 15 | issue = S2 | pages = 277s | date = 2000 | doi = 10.1016/S0924-9338(00)94205-6 | issn = 0924-9338 | doi-access = free | url = https://www.cambridge.org/core/services/aop-cambridge-core/content/view/AC9F3DF4DA6BDC8F6675C31F7744115F/S0924933800048185a.pdf/div-class-title-s31-03-the-history-of-czech-psychopharmacology-and-psychopharmacotherapy-of-affective-and-schizophrenic-disorders-div.pdf | access-date = 30 May 2025 }} It has been said to have actions similar to those of reserpine, a monoamine-depleting agent.{{cite journal | vauthors = Dlabac A, Macek K, Vanecek M, Trcka V | title = Reserpinový úćinek fenoharmanu | journal = Ceskoslovenska Fysiologie | volume = 8 | issue = 3 | pages = 177–178 | date = April 1959 | pmid = 13671512 | trans-title = Reserpine-like action of phenoharmane | language = Czech }}{{cite journal | vauthors = Trcka V, Dlabac A, Vanecek M | title = [The reserpine-like action of 1-benzyl-1,2,3,4-tetrahydronorharmane (fenoharman)] | journal = Journal de Physiologie | volume = 53 | pages = 488–489 | date = 1961 | pmid = 13777950 | language = French }}{{cite journal | vauthors = Nahunek K, Rodova A, Hosak L, Jaros M, Hadlik J | title = [Nialamid and its combinations with reserpine-like substances (fenoharman, reserpine) in the therapy of endogenous depressions] | journal = Deutsches Medizinisches Journal | volume = 13 | pages = 424–425 | date = July 1962 | pmid = 14477998 | language = German }}{{cite journal | vauthors = Rysanek K, Vitek V, Spankova H | title = [Comparative effects of Reserpine and Fenoharman on the absorption and liberation of serotonin in vivo and in vitro] | journal = Activitas Nervosa Superior | volume = 4 | pages = 220–221 | date = 1962 | pmid = 14495652 | language = Czech }} The drug has been reported to induce symptoms of depression analogously to reserpine.{{cite journal | vauthors = Bermanzohn PC, Siris SG | title = Akinesia: a syndrome common to parkinsonism, retarded depression, and negative symptoms of schizophrenia | journal = Comprehensive Psychiatry | volume = 33 | issue = 4 | pages = 221–232 | date = 1992 | pmid = 1353715 | doi = 10.1016/0010-440x(92)90045-r }}{{cite journal | vauthors = Tesařová O | title = Experimental Depression Caused by Apomorphine and Phenoharmane | journal = Pharmacopsychiatry | volume = 5 | issue = 1 | pages = 13–19 | date = 1972 | doi = 10.1055/s-0028-1094329 | issn = 0176-3679 | url = http://www.thieme-connect.de/DOI/DOI?10.1055/s-0028-1094329 | access-date = 30 May 2025 }} Fenharmane was developed in Czechoslovakia in the late 1950s.{{cite journal | vauthors = Vinar O | title = [Use of Fenoharman, a new Czechoslovakian preparation, in psychiatry (preliminary communication)] | journal = Casopis Lekaru Ceskych | volume = 99 | pages = 1422–1424 | date = November 1960 | pmid = 13781443 | language = Czech }}
See also
References
{{Reflist}}
{{Tryptamines}}
{{Psychoactive-stub}}