fenleuton

{{short description|5-lipoxygenase inhibitor}}

{{Drugbox

| Verifiedfields =

| verifiedrevid =

| IUPAC_name = 1-{4-[3-(4-Fluorophenoxy)phenyl]-3-butyn-2-yl}-1-hydroxyurea

| image = Fenleuton skeletal.svg

| width = 200

| tradename = Lofrin

| CAS_number_Ref =

| CAS_number = 141579-54-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LG64454O6I

| ATC_prefix = none

| ATC_suffix =

| PubChem =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 65045

| KEGG_Ref =

| KEGG = D04151

| ChEMBL_Ref =

| ChEMBL =

| C=17 | H=15 | O=3 | N=2 | F=1

| smiles = CC(C#Cc1cccc(c1)Oc2ccc(cc2)F)N(C(=O)N)O

| StdInChI_Ref =

| StdInChI = InChI=1S/C17H15FN2O3/c1-12(20(22)17(19)21)5-6-13-3-2-4-16(11-13)23-15-9-7-14(18)8-10-15/h2-4,7-12,22H,1H3,(H2,19,21)

| StdInChIKey_Ref =

| StdInChIKey = MWXPQCKCKPYBDR-UHFFFAOYSA-N{{cite web|url=http://www.chemspider.com/Chemical-Structure.65045.html|title=1-{4-[3-(4-Fluorophenoxy)phenyl]-3-butyn-2-yl}-1-hydroxyurea|author=|date=|work=chemspider.com|accessdate=24 December 2015}}

}}

Fenleuton (trade name Lofrin) is a drug that acts as a 5-lipoxygenase inhibitor and inhibits leukotriene (LTB4, LTC4, LTD4, and LTE4) formation. It has been studied for potential use in veterinary medicine to treat respiratory diseases such as chronic obstructive pulmonary disease (COPD) in horses.{{cite journal | pmid = 9673966 |title=Effect of the 5-lipoxygenase inhibitor, fenleuton, on antigen-induced neutrophil accumulation and lung function changes in horses with chronic obstructive pulmonary disease | journal = J Vet Pharmacol Ther | date = 1998 | volume = 21 | issue = 3 | pages = 241–246 |vauthors=Marr KA, Lees P, Page CP, Cunningham FM | doi=10.1046/j.1365-2885.1998.00127.x}}

References

{{Reflist|2}}

{{Leukotrienergics}}

Category:Ureas

Category:Phenyl compounds

Category:Alkyne derivatives

Category:Leukotriene pathway inhibitors

{{respiratory-system-drug-stub}}