fenoxazoline

{{Short description|Chemical compound}}

{{One source|date=September 2014}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447929930

| IUPAC_name = 2-[(2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole

| image = Fenoxazoline.svg

| width = 175

| tradename = Aturgyl, Nasofelin, Nebulicina

| Drugs.com = {{drugs.com|international|fenoxazoline}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only (BR)

| routes_of_administration = Topical (nasal solution)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 4846-91-7

| ATC_prefix = R01

| ATC_suffix = AA12

| PubChem = 71899

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 14012

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64911

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 97JJW1W1R3

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07372

| C=13 | H=18 | N=2 | O=1

| SMILES = CC(C)C1=CC=CC=C1OCC2=NCCN2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H18N2O/c1-10(2)11-5-3-4-6-12(11)16-9-13-14-7-8-15-13/h3-6,10H,7-9H2,1-2H3,(H,14,15)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GFYSWQDCHLWRMQ-UHFFFAOYSA-N

}}

Fenoxazoline (trade name Aturgyl in Brazil) is a nasal decongestant.{{cite journal | vauthors = Lorino AM, Lofaso F, Dahan E, Coste A, Harf A, Lorino H | title = Combined effects of a mechanical nasal dilator and a topical decongestant on nasal airflow resistance | journal = Chest | volume = 115 | issue = 6 | pages = 1514–8 | date = June 1999 | pmid = 10378542 | doi = 10.1378/chest.115.6.1514 }}

Fenmetozole has the precise same formula, albeit instead of an ortho-isopropyl group, 3',4'-dich was chosen instead.