fenspiride

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 406208293

| IUPAC_name = 8-(2-phenylethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one

| image = Fenspiride.svg

| width = 200

| image2 = Fenspiride ball-and-stick model.png

| width2 = 230

| tradename = Eurespal, Pneumorel

| Drugs.com = {{drugs.com|international|fenspiride}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability = 90%{{cite journal | vauthors = Montes B, Catalan M, Roces A, Jeanniot JP, Honorato JM | title = Single dose pharmacokinetics of fenspiride hydrochloride: phase I clinical trial | journal = European Journal of Clinical Pharmacology | volume = 45 | issue = 2 | pages = 169–72 | year = 1993 | pmid = 7901024 | doi = 10.1007/bf00315501 | s2cid = 20605939 }}

| metabolism =

| elimination_half-life = 14–16 hours

| excretion = Urine (90%), feces (~10%)

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 5053-06-5

| ATC_prefix = R03

| ATC_suffix = BX01

| ATC_supplemental = {{ATC|R03|DX03}}

| PubChem = 68626

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08979

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = S983QC7HKM

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07949

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 576127

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3227

| C=15 | H=20 | N=2 | O=2

| smiles = c1ccc(cc1)CCN2CCC3(CC2)CN=C(O3)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H20N2O2/c18-14-16-12-15(19-14)7-10-17(11-8-15)9-6-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,18)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = FVNFBBAOMBJTST-UHFFFAOYSA-N

}}

Fenspiride (INN, brand names Eurespal, Pneumorel and others) is an oxazolidinone spiro compound used as a drug in the treatment of certain respiratory diseases.{{cite journal | vauthors = Płusa T, Nawacka D | title = [Efficacy and tolerance of fenspiride in adult patients with acute respiratory tract infections] | journal = Polski Merkuriusz Lekarski | volume = 5 | issue = 30 | pages = 368–71 | date = December 1998 | pmid = 10101527 }} The pharmacotherapeutic classification is antitussives. In Russia it was approved for the treatment of acute and chronic inflammatory diseases of ENT organs (ear, nose, throat) and the respiratory tract (like rhinopharyngitis, laryngitis, tracheobronchitis, otitis and sinusitis), as well as for maintenance treatment of asthma.{{cite web|title=Эреспал (Eurespal) Prescribing Information. VIDAL Drug Compendium|url=http://www.vidal.ru/poisk_preparatov/eurespal~34706.htm|access-date=6 February 2014|language=Russian}} Russia, Romania, France and other European countries withdrew fenspiride-based drugs from the market due to the risk of QT prolongation and torsades de pointes.{{Cite web|url=https://www.ema.europa.eu/en/medicines/human/referrals/fenspiride-containing-medicinal-products|title=Fenspiride containing medicinal products|date=2019-02-15|website=European Medicines Agency|language=en|access-date=2019-06-12}} Fenspiride is known to have activity as an alpha-1 blocker, H1 antagonist, it also inhibits PDE3, PDE4, PDE5 with -logIC50 values of 3.44, 4.16, 3.8 respectively.{{cite journal | vauthors = Jankowski R | title = [ENT inflammation and importance of fenspiride] | language = French | journal = Presse Med | volume = 31 Spec No 1 | issue = | pages = HS7–10 | date = September 2002 | pmid = 12378970 | doi = | url = }}