fensulfothion

{{Chembox

| ImageFile = Fensulfothion.svg

| PIN = O,O-Diethyl O-[4-(methanesulfinyl)phenyl] phosphorothioate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 115-90-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VB39B105PO

| PubChem = 8292

| ChemSpiderID = 7991

| SMILES = S=P(Oc1ccc(cc1)S(=O)C)(OCC)OCC

| InChI = 1/C11H17O4PS2/c1-4-13-16(17,14-5-2)15-10-6-8-11(9-7-10)18(3)12/h6-9H,4-5H2,1-3H3

| InChIKey = XDNBJTQLKCIJBV-UHFFFAOYAH

| StdInChI = 1S/C11H17O4PS2/c1-4-13-16(17,14-5-2)15-10-6-8-11(9-7-10)18(3)12/h6-9H,4-5H2,1-3H3

| StdInChIKey = XDNBJTQLKCIJBV-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=11 | H=17 | O=4 | P=1 | S=2

| Appearance = Brown liquid or yellow oil

| Density = 1.20 g/mL (20°C)

| MeltingPt =

| BoilingPt =

| Solubility = 0.2% (25°C)

}}

|Section3={{Chembox Hazards

| MainHazards = combustible

| FlashPt =

| AutoignitionPt =

| PEL = none{{PGCH|0284}}

| IDLH = N.D.

| REL = TWA 0.1 mg/m³

}}

}}

Fensulfothion is an organophosphorus compound with the formula {{chem2|CH2S(O)C6H4OP(S)(OC2H5)2}}. It is an insecticide and nematicide that acts by inhibiting the enzyme acetylcholinesterase. Chemically, it is classified as a thiophosphate.{{cite book |doi=10.1002/14356007.s14_s01 |chapter=Insect Control, 2. Individual Insecticides |title=Ullmann's Encyclopedia of Industrial Chemistry |date=2014 |last1=Metcalf Deceased |first1=Robert L. |last2=Horowitz |first2=Abraham Rami |pages=1–94 |isbn=978-3-527-30673-2 }} It is widely used on corn, onions, rutabagas, pineapple, bananas, sugar cane, sugar beets, pea nuts, etc.