fentiazac

{{Short description|NSAID analgesic medication}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447984130

| IUPAC_name = 2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid

| image = fentiazac.png

| image_class = skin-invert-image

| image2 = Fentiazac-3D-balls.png

| image_class2 = bg-transparent

| tradename = Norvedan

| Drugs.com = {{drugs.com|international|fentiazac}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 18046-21-4

| ATC_prefix = M02

| ATC_suffix = AA14

| PubChem = 28871

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0YHF6E6NLS

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01975

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 26854

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 589092

| C=17 | H=12 | Cl=1 | N=1 | O=2 | S=1

| smiles = c1ccc(cc1)c2nc(c(s2)CC(=O)O)c3ccc(cc3)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H12ClNO2S/c18-13-8-6-11(7-9-13)16-14(10-15(20)21)22-17(19-16)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,21)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JIEKMACRVQTPRC-UHFFFAOYSA-N

| melting_point = 162-163

}}

Fentiazac is a thiazole-based nonsteroidal anti-inflammatory drug (NSAID) developed for use in joint and muscular pain.{{cite book | vauthors = Lombardino JG |title=Nonsteroidal antiinflammatory drugs |date=1985 |publisher=Wiley |location=New York |isbn=978-0-471-89803-0 | volume = 247 | issue = 814 | pages= 285 }} Like most other NSAIDs, it acts through inhibition of prostaglandin synthesis, via non-selective inhibition of both COX-1 and COX-2. First described in 1974, it was synthesized using the Hantzsch thiazole synthesis.{{cite journal | vauthors = Brown K, Cater DP, Cavalla JF, Green D, Newberry RA, Wilson AB | title = Nonsteroidal antiinflammatory agents. 1.2,4-Diphenylthiazole-5-acetic acid and related compounds | journal = Journal of Medicinal Chemistry | volume = 17 | issue = 11 | pages = 1177–1181 | date = November 1974 | pmid = 4414839 | doi = 10.1021/jm00257a010 }}

Fentiazac was marketed under the trade-name Norvedan (among others), but its market status is currently unknown and assumed to be discontinued.{{Cite web | work = NCATS Inxight Drugs | publisher = National Center for Advancing Translational Sciences (NCATS); U.S. National Institutes of Health | title = FENTIAZAC |url=https://drugs.ncats.io/substance/0YHF6E6NLS |access-date=2023-06-08 |language=en}}