fenyramidol

{{Short description|Muscle relaxant drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 376112914

| IUPAC_name = 1-phenyl-2-(pyridin-2-ylamino)ethanol

| image = phenyramidol.png

| tradename = Cabral

| Drugs.com = {{drugs.com|international|fenyramidol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 553-69-5

| ATC_prefix = M03

| ATC_suffix = BX30

| PubChem = 9470

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = R3V02WL7O3

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1697767

| ChemSpiderID = 9098

| C=13 | H=14 | N=2 | O=1

| smiles = C1=CC=CC(=C1)C(CNC2=NC=CC=C2)O

| StdInChI = 1S/C13H14N2O/c16-12(11-6-2-1-3-7-11)10-15-13-8-4-5-9-14-13/h1-9,12,16H,10H2,(H,14,15)

| StdInChIKey = ZEAJXCPGHPJVNP-UHFFFAOYSA-N

}}

Fenyramidol (INN) or phenyramidol (BAN, USAN), trade name Cabral, is a pharmaceutical drug which acts as a muscle relaxant.{{cite journal | vauthors = O'Dell TB | title = Pharmacology of phenyramidol (IN511) with emphasis on analgesic and muscle-relaxant effects | journal = Annals of the New York Academy of Sciences | volume = 86 | pages = 191–202 | date = March 1960 | issue = 1 | pmid = 14428054 | doi = 10.1111/j.1749-6632.1960.tb42799.x | bibcode = 1960NYASA..86..191O }}