feprazone

{{Short description|NSAID analgesic drug}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 444188860

| IUPAC_name = 4-(3-methylbut-2-enyl)-1,2-di(phenyl)pyrazolidine-3,5-dione

| image = feprazone.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|feprazone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 30748-29-9

| ATC_prefix = M02

| ATC_suffix = AA16

| PubChem = 35455

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 32612

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7BVX6J0CGR

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01305

| C=20 | H=20 | N=2 | O=2

| smiles = O=C2N(c1ccccc1)N(C(=O)C2C\C=C(/C)C)c3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H20N2O2/c1-15(2)13-14-18-19(23)21(16-9-5-3-6-10-16)22(20(18)24)17-11-7-4-8-12-17/h3-13,18H,14H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RBBWCVQDXDFISW-UHFFFAOYSA-N

}}

Feprazone (or prenazone) is a drug used for joint and muscular pain.{{cite journal | vauthors = Koyama T, Izawa Y, Wada H, Makita T, Hashimoto Y, Enomoto M | title = Toxicological aspects of feprazone, a new nonsteroidal anti-inflammatory drug | journal = Toxicology and Applied Pharmacology | volume = 64 | issue = 2 | pages = 255–70 | date = June 1982 | pmid = 7123554 | doi = 10.1016/0041-008X(82)90222-8 | bibcode = 1982ToxAP..64..255K }}

It is an analog of phenylbutazone but instead of a n-butyl group it is prenylated.

References

{{reflist}}

{{Anti-inflammatory and antirheumatic products}}

{{Topical products for joint and muscular pain}}

Category:Nonsteroidal anti-inflammatory drugs

Category:Pyrazolidindiones

{{musculoskeletal-drug-stub}}