feprazone
{{Short description|NSAID analgesic drug}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 444188860
| IUPAC_name = 4-(3-methylbut-2-enyl)-1,2-di(phenyl)pyrazolidine-3,5-dione
| image = feprazone.png
| image_class = skin-invert-image
| tradename =
| Drugs.com = {{drugs.com|international|feprazone}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 30748-29-9
| ATC_prefix = M02
| ATC_suffix = AA16
| PubChem = 35455
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 32612
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7BVX6J0CGR
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01305
| C=20 | H=20 | N=2 | O=2
| smiles = O=C2N(c1ccccc1)N(C(=O)C2C\C=C(/C)C)c3ccccc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H20N2O2/c1-15(2)13-14-18-19(23)21(16-9-5-3-6-10-16)22(20(18)24)17-11-7-4-8-12-17/h3-13,18H,14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RBBWCVQDXDFISW-UHFFFAOYSA-N
}}
Feprazone (or prenazone) is a drug used for joint and muscular pain.{{cite journal | vauthors = Koyama T, Izawa Y, Wada H, Makita T, Hashimoto Y, Enomoto M | title = Toxicological aspects of feprazone, a new nonsteroidal anti-inflammatory drug | journal = Toxicology and Applied Pharmacology | volume = 64 | issue = 2 | pages = 255–70 | date = June 1982 | pmid = 7123554 | doi = 10.1016/0041-008X(82)90222-8 | bibcode = 1982ToxAP..64..255K }}
It is an analog of phenylbutazone but instead of a n-butyl group it is prenylated.
References
{{reflist}}
{{Anti-inflammatory and antirheumatic products}}
{{Topical products for joint and muscular pain}}
Category:Nonsteroidal anti-inflammatory drugs
{{musculoskeletal-drug-stub}}