fesoterodine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 461100276
| image = Fesoterodine.svg
| width = 250
| alt =
| image2 = Fesoterodine 3D spacefill.png
| width2 = 220
| alt2 = Space-filling model of the fesoterodine molecule
| caption =
| pronounce =
| tradename = Fesobig , Toviaz
| Drugs.com = {{drugs.com|monograph|fesoterodine-fumarate}}
| MedlinePlus = a609021
| DailyMedID = Fesoterodine
| routes_of_administration = By mouth
| class =
| ATC_prefix = G04
| ATC_suffix = BD11
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA = Rx-only
| legal_CA_comment = {{cite web | title=Product monograph brand safety updates | website=Health Canada | date=6 June 2024 | url=https://www.canada.ca/en/health-canada/services/drugs-health-products/drug-products/drug-product-database/label-safety-assessment-update/product-monograph-brand-safety-updates.html | access-date=8 June 2024}}
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_EU = Rx-only
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability = 52% (active metabolite)
| protein_bound = 50% (active metabolite)
| metabolism = Liver (CYP2D6- and 3A4-mediated)
| elimination_half-life = 7–8 hours (active metabolite)
| excretion = Kidney (70%) and fecal (7%)
| CAS_number_Ref = {{cascite|changed|CAS}}
| CAS_number = 286930-02-7
| CAS_supplemental =
| PubChem = 6918558
| IUPHAR_ligand = 7473
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB06702
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5293755
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 621G617227
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07226
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201764
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name = [2-[(1R)-3-(Di(propan-2-yl)amino)-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate
| C=26 | H=37 | N=1 | O=3
| SMILES = O=C(Oc1ccc(cc1[C@@H](c2ccccc2)CCN(C(C)C)C(C)C)CO)C(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C26H37NO3/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3/t23-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DCCSDBARQIPTGU-HSZRJFAPSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Fesoterodine (INN, used as the fumarate under the brand name Toviaz) is an antimuscarinic drug developed by Schwarz Pharma AG to treat overactive bladder syndrome (OAB).{{cite web| url=http://www.medicalnewstoday.com/articles/41688.php| title=Fesoterodine, New Drug Candidate For Treatment For Overactive Bladder – Pfizer To Acquire Exclusive Worldwide Rights| date=17 April 2006| publisher=Medical News Today| access-date=2 November 2007| archive-date=16 May 2011| archive-url=https://web.archive.org/web/20110516020517/http://www.medicalnewstoday.com/articles/41688.php| url-status=dead}} It was approved by the European Medicines Agency in April 2007,{{cite web |url= http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |title=Toviaz: European Public Assessment Report, Revision 3 - Published 02/06/08 |date=2 June 2008 |publisher=European Medicines Agency |url-status=dead |archive-url=https://web.archive.org/web/20080401005811/http://www.emea.europa.eu/humandocs/Humans/EPAR/toviaz/toviaz.htm |archive-date=2008-04-01 }} the US Food and Drug Administration on October 31, 2008 {{cite press release
| title = Pfizer's Toviaz (fesoterodine fumarate) Receives FDA Approval for the Treatment of Overactive Bladder
| publisher = Pfizer Inc.
| date = 2008-10-31
| url = https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html
| access-date = 2008-11-06
| archive-date = 2018-09-20
| archive-url = https://web.archive.org/web/20180920075736/https://www.drugs.com/newdrugs/pfizer-s-toviaz-fesoterodine-fumarate-receives-fda-approval-overactive-bladder-1167.html
| url-status = live
}} and Health Canada on February 9, 2012.{{Cite web |url=http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |title=Notice of Decision for TOVIAZ |access-date=2012-04-20 |archive-url=https://web.archive.org/web/20120423124138/http://www.hc-sc.gc.ca/dhp-mps/prodpharma/sbd-smd/drug-med/nd_ad_2012_toviaz_142326-eng.php |archive-date=2012-04-23 |url-status=dead }}
Fesoterodine is a prodrug. It is broken down into its active metabolite, desfesoterodine, by plasma esterases.
Efficacy
Fesoterodine has the advantage of allowing more flexible dosage than other muscarinic antagonists.{{cite journal | vauthors = Vella M, Cardozo L | title = Review of fesoterodine | journal = Expert Opinion on Drug Safety | volume = 10 | issue = 5 | pages = 805–8 | date = September 2011 | pmid = 21639817 | doi = 10.1517/14740338.2011.591377 | s2cid = 9653506 }} Its tolerability and side effects are similar to other muscarinic antagonists and as a new drug seems unlikely to make great changes in practices of treatment for overactive bladder.
A Japanese study from 2017, showed that urgency and urge incontinence are improved after 3 days administration of the drug, with full efficacy able to be judged after 7 days administration. Overactive bladder was found to be resolved in 88% of patients after seven days usage. "{{cite journal | vauthors = Sato N, Fuji K, Ogawa Y | doi = 10.15369/sujms.29.201| title = Transactions of The Showa University Society: The 335th Meeting| journal = The Showa University Journal of Medical Sciences| volume = 29| issue = 2| pages = 201–217
| year = 2017 |issn=2185-0968| doi-access = free}}
References
{{Reflist}}
{{Urologicals}}
{{Muscarinic acetylcholine receptor modulators}}
{{Portal bar | Medicine}}
Category:Diisopropylamino compounds
Category:Drugs developed by Pfizer
Category:M1 receptor antagonists
Category:M2 receptor antagonists
Category:M3 receptor antagonists
Category:M4 receptor antagonists