festuclavine

{{Chembox

| ImageFile = Festuclavine.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = 6,8β-Dimethylergoline

| SystematicName = (6aR,9R,10aR)-7,9-Dimethyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 436-41-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GLS7Y869AV

| PubChem = 332915

| ChemSpiderID = 294963

| SMILES = C[C@@H]1C[C@@H]2c3cccc4c3c(c[nH]4)C[C@H]2N(C1)C

| StdInChI = 1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13-,15-/m1/s1

| StdInChIKey = VLMZMRDOMOGGFA-WDBKCZKBSA-N}}

|Section2={{Chembox Properties

| C=16 | H=20 | N=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Festuclavine is an ergoline fungal isolate.{{Cite journal | pmid = 20526482 | year = 2010 | last1 = Wallwey | first1 = C | last2 = Matuschek | first2 = M | last3 = Xie | first3 = XL | last4 = Li | first4 = SM | title = Ergot alkaloid biosynthesis in Aspergillus fumigatus: Conversion of chanoclavine-I aldehyde to festuclavine by the festuclavine synthase FgaFS in the presence of the old yellow enzyme FgaOx3 | volume = 8 | issue = 15 | pages = 3500–8 | doi = 10.1039/c003823g | journal = Organic & Biomolecular Chemistry}}