firategrast

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| image = Firategrast_structure.png

| width =

| tradename =

| pregnancy_category =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 402567-16-2

| CAS_supplemental =

| PubChem = 9935681

| IUPHAR_ligand = 11486

| DrugBank = DB12732

| ChemSpiderID = 8111309

| UNII = OJY3SK9H5F

| KEGG = D06590

| ChEBI =

| ChEMBL = 2104967

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = (2S)-2-[(2,6-difluorobenzoyl)amino]-3-[4-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]phenyl]propanoic acid

| C = 27 | H = 27 | F = 2 | N = 1 | O = 6

| SMILES = CCOCC1=CC(=C(C(=C1)OC)C2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)C3=C(C=CC=C3F)F)OC

| StdInChI = 1S/C27H27F2NO6/c1-4-36-15-17-13-22(34-2)24(23(14-17)35-3)18-10-8-16(9-11-18)12-21(27(32)33)30-26(31)25-19(28)6-5-7-20(25)29/h5-11,13-14,21H,4,12,15H2,1-3H3,(H,30,31)(H,32,33)/t21-/m0/s1

| StdInChIKey = YLFZHHDVRSYTKT-NRFANRHFSA-N

}}

Firategrast (SB-683699) is an experimental drug which is an orally active and selective antagonist of the α4β1 and α4β7 integrin receptors. It reduces trafficking of lymphocytes into the central nervous system, and is in clinical trials for the treatment of multiple sclerosis. It may also have application in the treatment of breast cancer.{{cite journal | vauthors = Miller DH, Weber T, Grove R, Wardell C, Horrigan J, Graff O, Atkinson G, Dua P, Yousry T, Macmanus D, Montalban X | title = Firategrast for relapsing remitting multiple sclerosis: a phase 2, randomised, double-blind, placebo-controlled trial | journal = The Lancet. Neurology | volume = 11 | issue = 2 | pages = 131–139 | date = February 2012 | doi = 10.1016/S1474-4422(11)70299-X | pmid = 22226929 }}{{cite journal | vauthors = Piehl F | title = Current and emerging disease-modulatory therapies and treatment targets for multiple sclerosis | journal = Journal of Internal Medicine | volume = 289 | issue = 6 | pages = 771–791 | date = June 2021 | doi = 10.1111/joim.13215 | pmid = 33258193 | pmc = 8246813 }}{{cite journal | vauthors = Yousefian Naeini Z, Esfandiari N, Hashemi M, Hushmandi K, Arbabian S, Entezari M | title = Introduced the ITGB1-DT as a novel biomarker associated with five potential drugs using bioinformatics analysis of breast cancer proteomics data and RT-PCR | journal = Molecular and Cellular Probes | volume = 71 | pages = 101930 | date = October 2023 | doi = 10.1016/j.mcp.2023.101930 | pmid = 37690573 | doi-access = free }}

References