flavokavain A

{{Chembox

| Watchedfields = changed

| verifiedrevid = 455169884

| ImageFile = Flavokavain A.svg

| ImageSize = 200px

| PIN = 2′-Hydroxy-4,4′,6′-trimethoxychalcone

| OtherNames = Flavokawain A

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 37951-13-6

| Beilstein = 2224776

| ChEBI = 157725

| ChEMBL = 243829

| ChemSpiderID = 4511445

| EC_number = 636-475-1

| UNII_Ref = {{fdacite|correct|FDA}}

| PubChem = 5355469

| UNII = 8OM2XZ2ZM3

| StdInChI=1S/C18H18O5/c1-21-13-7-4-12(5-8-13)6-9-15(19)18-16(20)10-14(22-2)11-17(18)23-3/h4-11,20H,1-3H3/b9-6+

| StdInChIKey = CGIBCVBDFUTMPT-RMKNXTFCSA-N

| SMILES = O=C(C2=C(O)C=C(OC)C=C2OC)/C=C/C1=CC=C(OC)C=C1

}}

|Section2={{Chembox Properties

| C=18 | H=18 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Flavokavain A is a flavokavain found in the kava plant.{{cite journal|title=Kavalactones from Piper methysticum, and their 13C NMR spectroscopic analyses|journal=Phytochemistry|date=February 2002|first=H. Ranjith W.|last=Dharmaratne|author2=N. P. Dhammika Nanayakkara |author3=Ikhlas A. Khan |volume=59|issue=4|pages=429–33|pmid=11830162 |doi=10.1016/S0031-9422(01)00443-5 }} It induces apoptosis in bladder cancer cells via a Bax protein-dependent and mitochondria-dependent apoptotic pathway.{{cite journal|title=Flavokawain A, a novel chalcone from kava extract, induces apoptosis in bladder cancer cells by involvement of Bax protein-dependent and mitochondria-dependent apoptotic pathway and suppresses tumor growth in mice.|vauthors=Zi X, Simoneau AR |journal=Cancer Research|pmid=15833884|doi=10.1158/0008-5472.CAN-04-3803|volume=65|issue=8|date=April 2005|pages=3479–86|doi-access=free|url=https://aacr.figshare.com/articles/journal_contribution/Supplementary_Figure_S1_from_Flavokawain_A_a_Novel_Chalcone_from_Kava_Extract_Induces_Apoptosis_in_Bladder_Cancer_Cells_by_Involvement_of_Bax_Protein-Dependent_and_Mitochondria-Dependent_Apoptotic_Pathway_and_Suppresses_Tumor_Growth_in_Mice/22365111/1/files/39809379.pdf}}

Flavokavains A and B enhance hepatotoxicity of paracetamol, underscoring a potentially serious interaction between paracetamol and kava.