flazalone

{{Short description|NSAID and cocaine addiction agent.}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Flazalone

| image = Flazalone.svg

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 21221-18-1

| PubChem = 36663

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 33682

| UNII = 5A1Y43ML91

| KEGG = D04189

| ChEBI =

| ChEMBL = 120951

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Flumefenine, R-760.

| C=19 | H=19 | F=2 | N=1 | O= 2

| IUPAC_name = (4-fluorophenyl)-[4-(4-fluorophenyl)-4-hydroxy-1-methylpiperidin-3-yl]methanone

| smiles = CN1CCC(C(C1)C(=O)C2=CC=C(C=C2)F)(C3=CC=C(C=C3)F)O

| StdInChI = 1S/C19H19F2NO2/c1-22-11-10-19(24,14-4-8-16(21)9-5-14)17(12-22)18(23)13-2-6-15(20)7-3-13/h2-9,17,24H,10-12H2,1H3

| StdInChIKey = PPQZABOURJVKNI-UHFFFAOYSA-N

}}

Flazalone is an anti-inflammatory drug that has not been approved as a medicine.{{cite journal | vauthors = Levy L, McClure D | title = The pharmacology of flazalone: a new class of anti-inflammatory agent | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 198 | issue = 2 | pages = 473–480 | date = August 1976 | doi = 10.1016/S0022-3565(25)30615-4 | pmid = 7668 }}{{cite web | title = Flazalone | work = Inxight Drugs | publisher = The National Center for Advancing Translational Sciences (NCATS) | url = https://drugs.ncats.io/drug/5A1Y43ML91 }}{{cite journal | vauthors=((Castañer, J.)), ((Arrigoni-Martelli, E.)) | journal=Drugs of the Future | title=Flazalone | volume=2 | issue=3 | pages=169 | date= 1977 | issn=0377-8282 | doi=10.1358/dof.1977.002.03.998237}}

According to Shaomeng Wang and co-workers, replacement of the para-fluoro halogen with a meta,para-dichloro substitution resulted in dopamine reuptake inhibitors useful in treating cocaine addiction.{{cite journal | vauthors = Wang S, Sakamuri S, Enyedy IJ, Kozikowski AP, Deschaux O, Bandyopadhyay BC, Tella SR, Zaman WA, Johnson KM | title = Discovery of a novel dopamine transporter inhibitor, 4-hydroxy-1-methyl-4-(4-methylphenyl)-3-piperidyl 4-methylphenyl ketone, as a potential cocaine antagonist through 3D-database pharmacophore searching. Molecular modeling, structure-activity relationships, and behavioral pharmacological studies | journal = Journal of Medicinal Chemistry | volume = 43 | issue = 3 | pages = 351–60 | date = February 2000 | pmid = 10669562 | doi = 10.1021/jm990516x | url = }}{{cite journal | vauthors = Wang S, Sakamuri S, Enyedy IJ, Kozikowski AP, Zaman WA, Johnson KM | title = Molecular modeling, structure--activity relationships and functional antagonism studies of 4-hydroxy-1-methyl-4-(4-methylphenyl)-3-piperidyl 4-methylphenyl ketones as a novel class of dopamine transporter inhibitors | journal = Bioorganic & Medicinal Chemistry | volume = 9 | issue = 7 | pages = 1753–64 | date = July 2001 | pmid = 11425577 | doi = 10.1016/s0968-0896(01)00090-6 | url = }}

File:Diclazalone.svg