flomoxef

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413515463

| IUPAC_name = (6R,7R)-7-[[2-(Difluoromethylsulfanyl)acetyl]amino]-3-[[1-(2-hydroxyethyl)tetrazol-5-yl]sulfanylmethyl]-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Flomoxef.png

| tradename = Flumarin

| Drugs.com = {{drugs.com|international|flomoxef}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 99665-00-6

| CAS_supplemental =

| ATC_prefix = J01

| ATC_suffix = DC14

| ATC_supplemental =

| PubChem = 65864

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = V9E5U5XF42

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07963

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 15413

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59274

| chemical_formula =

| C=15 | H=18 | F=2 | N=6 | O=7 | S=2

| smiles = CO[C@@]1([C@@H]2N(C1=O)C(=C(CO2)CSc3nnnn3CCO)C(=O)O)NC(=O)CSC(F)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H18F2N6O7S2/c1-29-15(18-8(25)6-31-13(16)17)11(28)23-9(10(26)27)7(4-30-12(15)23)5-32-14-19-20-21-22(14)2-3-24/h12-13,24H,2-6H2,1H3,(H,18,25)(H,26,27)/t12-,15+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UHRBTBZOWWGKMK-DOMZBBRYSA-N

| melting_point = 82.5

| melting_high = 87.5

}}

Flomoxef is an oxacephem antibiotic that was developed by Shionogi.

It has been classified either as a second-generation {{cite journal | vauthors = Masuda Z, Kurosaki Y, Ishino K, Yamauchi K, Sano S | title = Pharmacokinetic analysis of flomoxef in children undergoing cardiopulmonary bypass and modified ultrafiltration | journal = General Thoracic and Cardiovascular Surgery | volume = 56 | issue = 4 | pages = 163–169 | date = April 2008 | pmid = 18401677 | doi = 10.1007/s11748-007-0208-5 | s2cid = 23845740 }} or fourth-generation cephalosporin.{{cite journal | vauthors = Ito M, Ishigami T | title = The meaning of the development of flomoxef and clinical experience in Japan | journal = Infection | volume = 19 | issue = Suppl 5 | pages = S253–S257 | year = 1991 | pmid = 1783441 | doi = 10.1007/bf01645536 | s2cid = 25339977 }}

It was patented in 1982 and approved for medical use in 1988 under the trade name Flumarin.{{cite book | vauthors = Fischer J, Ganellin CR | title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=496 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA496 |language=en}}