fluacizine

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 437170931

| IUPAC_name = 3-Diethylamino-1-[2-(trifluoromethyl)phenothiazin-10-yl]-propan-1-one

| image = Fluacizine.svg

| alt = Skeletal formula of fluacizine

| width = 250px

| image2 = Fluacizine 3D spacefill.png

| alt2 = Space-filling model of the fluacizine molecule

| width2 = 200px

| tradename = Phtorazisin

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral, intramuscular injection

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 30223-48-4

| CAS_supplemental =
27312-93-2 (hydrochloride)

| ATC_prefix = None

| ATC_suffix =

| PubChem = 161562

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 141910

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = E2M3325B1R

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 92281

| synonyms = Fluoracizine; Fluoracyzine; Fluoracisine; Ftoracizin; Ftoracizine; Phthoracizin

| C=20 | H=21 | F=3 | N=2 | O=1 | S=1

| SMILES = FC(F)(F)c2cc1N(c3c(Sc1cc2)cccc3)C(=O)CCN(CC)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H21F3N2OS/c1-3-24(4-2)12-11-19(26)25-15-7-5-6-8-17(15)27-18-10-9-14(13-16(18)25)20(21,22)23/h5-10,13H,3-4,11-12H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VHEOUJNDDFHPGJ-UHFFFAOYSA-N

}}

Fluacizine, sold under the brand name Phtorazisin, is a tricyclic antidepressant (TCA) of the phenothiazine group which is or was marketed in Russia.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA555|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=555–}}{{cite book | author = O'Neil, Maryadele J. | title = The Merck index: an encyclopedia of chemicals, drugs, and biologicals | publisher = Merck Research Laboratories | location = Rahway, NJ | year = 2001 | isbn = 0-911910-13-1 | url = https://archive.org/details/merckindexency00onei | url-access = registration }}{{cite book|author=V. V. Zakusov|title=Pharmacology of Central Synapses|url=https://books.google.com/books?id=lrsgBQAAQBAJ&pg=PA190|date=22 October 2013|publisher=Elsevier|isbn=978-1-4831-4673-7|pages=190–}} Unlike other phenothiazines, fluacizine is not an antipsychotic, and can actually reverse catalepsy and extrapyramidal symptoms induced by antidopaminergic agents like antipsychotics, reserpine, and tetrabenazine as well as potentiate amphetamine-induced stereotypy. It is known to act as a norepinephrine reuptake inhibitor, antihistamine, and anticholinergic.{{cite journal | vauthors = Arefolov VA, Panasyuk LV, Raevskii KS, Kostyukov VI | title = Effect of fluacizine on the uptake of exogenous noradrenalin by the isolated rat vas deferens | journal = Bull. Exp. Biol. Med. | volume = 77 | issue = 3 | pages = 295–7 | year = 1974 | pmid = 4153328 | doi = 10.1007/BF00802484| s2cid = 13188296 }}{{cite journal | vauthors = Arefolov VA, Panasyuk LV | title = Effect of fluacizine on the uptake of exogenous noradrenalin | journal = Bull. Exp. Biol. Med. | volume = 77 | issue = 5 | pages = 520–3 | year = 1974 | pmid = 4441683 | doi = 10.1007/BF00797411| s2cid = 27205700 }}{{cite journal | vauthors = Arefolov VA, Panasiuk LV, Firsov VK | title = [Neuromediator content in the synaptic vesicles of rat adrenergic nerves in some pharmacological actions] | language = ru | journal = Farmakol Toksikol | volume = 38 | issue = 3 | pages = 285–9 | year = 1975 | pmid = 6305 }}{{cite book|title=Annual Reports in Medicinal Chemistry|url=https://books.google.com/books?id=52joNWUvZakC&pg=PA19|date=27 October 1972|publisher=Academic Press|isbn=978-0-08-058351-8|pages=19–}} The drug was developed in the 1960s and was marketed in the 1970s. It is the trifluoromethyl analogue of chloracizine.