fludorex

{{Short description|Stimulant appetite suppressant drug}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449582436

| IUPAC_name = (RS)-2-methoxy-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine

| image = Fludorex Structure.svg

| width =

| alt = Skeletal formula of fludorex

| image2 = Fludorex 3D spacefill.png

| alt2 = Space-filling model of the fludorex molecule

| tradename =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 15221-81-5

| ATC_prefix = none

| PubChem = 27139

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 346FQP00BI

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04205

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 25259

| C=11 | H=14 | F=3 | N=1 | O=1

| smiles = CNCC(C1=CC(=CC=C1)C(F)(F)F)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C11H14F3NO/c1-15-7-10(16-2)8-4-3-5-9(6-8)11(12,13)14/h3-6,10,15H,7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CXLOIJUDIPVKOU-UHFFFAOYSA-N

| synonyms =

}}

Fludorex is a stimulant anorexic agent of the phenethylamine chemical class.{{cite journal | vauthors = Beregi SL, Duhault J | title = Structure-anorectic activity relationships in substituted phenethylamines | journal = Arzneimittel-Forschung | volume = 27 | issue = 1 | pages = 116–8 | date = 1977 | pmid = 576809 }}