fludroxycortide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461101313

| IUPAC_name = 6-Fluoro-11,21-dihydroxy-16,17-[(l-methylethylidene)bis(oxy)]-(6α,11β,16α)-pregn-4-ene-3,20-dione

| image = Fludroxycortide.svg

| width = 250

| tradename = Cordran, Haelan

| Drugs.com = {{drugs.com|CONS|fludroxycortide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK = POM

| legal_US =

| legal_status =

| routes_of_administration = Topical

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7606

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1524-88-5

| ATC_prefix = D07

| ATC_suffix = AC07

| ATC_supplemental =

| PubChem = 15209

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00846

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 14475

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8EUL29XUQT

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00328

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201012

| C=24 | H=33 | F=1 | O=6

| SMILES = O=C1\C=C5/[C@](C)(CC1)[C@@H]2[C@H]([C@H]3[C@](C[C@@H]2O)([C@@]4(OC(O[C@@H]4C3)(C)C)C(=O)CO)C)C[C@@H]5F

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H33FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h7,13-14,16-17,19-20,26,28H,5-6,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = POPFMWWJOGLOIF-XWCQMRHXSA-N

| synonyms = 6α-Fluoro-16α-hydroxyhydrocortisone 16,17-acetonide; 6α-Fluoro-11β,16α,17α,21-tetrahydroxypregn-4-ene-3,20-dione 16,17-acetonide

}}

Fludroxycortide (INN, BAN, JAN), also known as flurandrenolide (USAN) and flurandrenolone,{{PubChemLink|15209}} is a synthetic topical corticosteroid and is used as an anti-inflammatory treatment for use on skin irritations. Trade names include Haelan (Typharm, UK) and Cordran (by Watson Pharmaceuticals, US).{{cite web | work = Drugs.com | url = https://www.drugs.com/international/fludroxycortide.html | title = Fludroxycortide | access-date = 2018-01-23 | archive-date = 2019-08-29 | archive-url = https://web.archive.org/web/20190829112244/https://www.drugs.com/international/fludroxycortide.html | url-status = dead }}{{cite web | work = Patient.info | url = http://patient.info/medicine/fludroxycortide-for-inflammatory-skin-conditions-haelan | title = Fludroxycortide | date = 30 August 2022 }}

Fludroxycortide is available in ointment, cream and as an impregnated tape (Haelan tape, Cordran tape). Licensed indications in the United Kingdom include recalcitrant dermatoses.[http://www.typharm.com/typharm/docs/Haelan_Tape_SPC.pdf Haelan Tape Summary of Product Characteristics]{{Dead link|date=December 2019 |bot=InternetArchiveBot |fix-attempted=yes }}{{cite journal | vauthors = Nakamura H, Motoyoshi S, Ishii K, Seto Y, Shimizu M | title = [Anti-inflammatory activity of a topical glucocorticoid, fludroxycortide tape in experimental animals (author's transl)] | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 76 | issue = 7 | pages = 595–607 | date = October 1980 | pmid = 7215997 | doi = 10.1254/fpj.76.595 | doi-access = free }}