flumizole

{{Short description|NSAID anti-inflammatory compound}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1H-imidazole

| image = Flumizole structure.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 36740-73-5

| ATC_prefix = none

| PubChem = 37518

| DrugBank =

| ChemSpiderID = 34419

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y4YQF944N9

| KEGG = D04211

| ChEMBL = 430150

| synonyms =

| C=18 | H=15 | F=3 | N=2 | O=2

| smiles = FC(F)(F)c2[nH]c(c(c1ccc(OC)cc1)n2)c3ccc(OC)cc3

| StdInChI=1S/C18H15F3N2O2/c1-24-13-7-3-11(4-8-13)15-16(23-17(22-15)18(19,20)21)12-5-9-14(25-2)10-6-12/h3-10H,1-2H3,(H,22,23)

| StdInChIKey = OPYFPDBMMYUPME-UHFFFAOYSA-N

}}

Flumizole is an antiinflammatory agent. More specifically, it is a nonsteroidal anti-inflammatory drug (NSAID) that acts via inhibition of the enzyme cyclooxygenase (COX).{{cite journal | vauthors = Wiseman EH, McIlhenny HM, Bettis JW | title = Flumizole, a new nonsteroidal anti-inflammatory agent | journal = Journal of Pharmaceutical Sciences | volume = 64 | issue = 9 | pages = 1469–75 | date = September 1975 | pmid = 810570 | doi = 10.1002/jps.2600640909 }}