fluopicolide

{{Chembox

| ImageFile = Fluopicolide structure.svg

| ImageSize = 200px

| PIN = 2,6-Dichloro-N-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methyl}benzamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 239110-15-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6TRO75M67P

| PubChem = 11159021

| ChemSpiderID = 9334122

| ChEBI = 81764

| SMILES = C1=CC(=C(C(=C1)Cl)C(=O)NCC2=C(C=C(C=N2)C(F)(F)F)Cl)Cl

| InChI = 1/C14H8Cl3F3N2O/c15-8-2-1-3-9(16)12(8)13(23)22-6-11-10(17)4-7(5-21-11)14(18,19)20/h1-5H,6H2,(H,22,23)

| InChIKey = GBOYJIHYACSLGN-UHFFFAOYAE

| StdInChI = 1S/C14H8Cl3F3N2O/c15-8-2-1-3-9(16)12(8)13(23)22-6-11-10(17)4-7(5-21-11)14(18,19)20/h1-5H,6H2,(H,22,23)

| StdInChIKey = GBOYJIHYACSLGN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=14 | H=8 | Cl=3 | F=3 | N=2 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Fluopicolide is a fungicide used in agriculture to control diseases caused by oomycetes such as late blight of potato. It is classed as an acylpicolide and its chemical name is 2,6-dichloro-N-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]methyl}benzamide.{{cite book|author1=Valérie Toquin |author2=Marie-Pascal Latorse |author3=Roland Beffa |title=Modern Crop Protection Compounds|url=https://books.google.com/books?id=rZsaM-K2vdMC&pg=PA831|year=2012|publisher=John Wiley & Sons|isbn=978-3-527-32965-6|pages=831–838}} The precise mode of action is not known, but it is thought to act by affecting spectrin-like proteins in the cytoskeleton of oomycetes.{{cite web|url=http://www.fao.org/fileadmin/templates/agphome/documents/Pests_Pesticides/JMPR/Report09/Fluopicolide.pdf|title=Fluopicolide Toxicology|publisher=Food and Agriculture Organization}} This mode of action differs from other available fungicides used to control oomycetes and it can inhibit the growth of strains that are resistant to phenylamides, strobilurin, dimethomorph and iprovalicarb. It has some systemic activity as it moves through the xylem towards the tips of stems, but does not get transported to the roots. It affects the motility of zoospores, the germination of cysts, the growth of the mycelium and sporulation.{{cite book|author1=U. Gisi|author2=Ilan Chet|author2-link=Ilan Chet|author3=Maria Lodovica Gullino|title=Recent Developments in Management of Plant Diseases|url=https://books.google.com/books?id=76qLQtFKSLQC&pg=PA18|date=18 September 2009|publisher=Springer Science & Business Media|isbn=978-1-4020-8804-9|page=19}} Bayer CropScience developed the compound and it was first released as a commercial product in 2006.{{cite news|title=Bayer CropScience's Infinito receives best combined rating|publisher=Biotech Week|date=2007-06-20}}