fluvalinate

{{Short description|Chemical compound}}

{{update|date=August 2016}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 431991211

| IUPAC_name = [Cyano-(3-phenoxyphenyl)methyl] 2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoate

| image = Fluvalinat Structural Formula V3.svg

| tradename =

| Drugs.com = {{drugs.com|international|fluvalinate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 69409-94-5

| CAS_supplemental =
{{CAS|102851-06-9}} (tau-fluvalinate)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 364G5G03VC

| ATCvet = yes

| ATC_prefix = P53

| ATC_suffix = AC10

| ATC_supplemental =

| PubChem = 50516

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C10989

| ChEBI = 5135

| ChEMBL = 3185183

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 45805

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H22ClF3N2O3/c1-16(2)24(32-22-12-11-18(14-21(22)27)26(28,29)30)25(33)35-23(15-31)17-7-6-10-20(13-17)34-19-8-4-3-5-9-19/h3-14,16,23-24,32H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = INISTDXBRIBGOC-UHFFFAOYSA-N

| chemical_formula =

| C=26 | H=22 | Cl=1 | F=3 | N=2 | O=3

| smiles = CC(C)C(Nc1ccc(C(F)(F)F)cc1Cl)C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1

}}

Fluvalinate{{Cite web |title=Fluvalinate - an overview {{!}} ScienceDirect Topics |url=https://www.sciencedirect.com/topics/agricultural-and-biological-sciences/fluvalinate |access-date=2023-11-03 |website=www.sciencedirect.com}} is a synthetic pyrethroid chemical compound contained as an active agent in the products Apistan,{{Cite web |date=2023-06-28 |title=Apistan: Varroa Control |url=https://www.vita-europe.com/beehealth/products/apistan/ |access-date=2023-11-03 |website=Vita Bee Health |language=en-US}} Klartan, and Minadox, that is an acaricide (specifically, a miticide), commonly used to control Varroa mites in honey bee colonies,{{cn|date=August 2016}} infestations that constitute a significant disease of such insects.

Fluvalinate is a stable, nonvolatile,{{citation |url=http://sitem.herts.ac.uk/aeru/ppdb/en/Reports/608.htm |title=tau-fluvalinate |work=Pesticide Properties DataBase |publisher=University of Hertfordshire |accessdate=June 24, 2017}} viscous, heavy oil (technical) soluble in organic solvents.{{citation |url=https://pubchem.ncbi.nlm.nih.gov/compound/Tau-fluvalinate |title=Tau-fluvalinate |work=PubChem. The Open Chemistry Database |publisher=National Institutes of Health |accessdate=June 24, 2017}}

Although the compound may be found in drones, a study has found honey samples virtually absent of fluvalinate, on account of its affinity to beeswax.{{citation | author = MAF Biosecurity New Zealand | date = 2001 | title = A Review of Treatment Options for Control of Varroa Mite in New Zealand [HortResearch Client Report No. 2001/249] | url = http://www.biosecurity.govt.nz/files/pests/varroa/papers/varroa-treatment-options.pdf | access-date = 28 August 2016 | quote = This report was commissioned by MAF to aid in internal decision making only. This report in no way constitutes MAF's advice to beekeepers and is useful only as background information. | archive-url=https://web.archive.org/web/20160911015922/http://www.biosecurity.govt.nz/files/pests/varroa/papers/varroa-treatment-options.pdf | archive-date=2016-09-11 | url-status=dead}}{{better source|date=August 2016}}