fominoben

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Fominoben.svg

| alt =

| caption =

| tradename = Broncomenal, Deronyl, Finaten, Noleptan, Oleptan, Terion, Tosifar, Tussirama{{cite book | editor = Swiss Pharmaceutial Society |title=Index Nominum 2000: International Drug Directory |url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA261 |date=January 2000 |publisher=Taylor & Francis |isbn=978-3-88763-075-1 |pages=470 }}

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| IUPAC_name = N-[3-chloro-2-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]phenyl]benzamide

| CAS_number = 18053-31-1

| CAS_number_Ref = {{Cascite|correct|CAS}}

| PubChem = 3407

| DrugBank = DB08968

| ChemSpiderID = 3290

| ChEMBL = 1697837

| ChEBI = 135639

| KEGG = D07988

| UNII = TJ2KK6NYJS

| C = 21 | H = 24 | Cl = 1 | N = 3 | O = 3

| smiles = CN(CC1=C(C=CC=C1Cl)NC(=O)C2=CC=CC=C2)CC(=O)N3CCOCC3

| StdInChI = 1S/C21H24ClN3O3/c1-24(15-20(26)25-10-12-28-13-11-25)14-17-18(22)8-5-9-19(17)23-21(27)16-6-3-2-4-7-16/h2-9H,10-15H2,1H3,(H,23,27)

| StdInChIKey = KSNNEUZOAFRTDS-UHFFFAOYSA-N

}}

Fominoben is an antitussive agent of the benzanilide class, formerly marketed under the name Noleptan.{{cite web |url=https://drugs.ncats.io/drug/TJ2KK6NYJS |access-date=March 25, 2021 |title=FOMINOBEN |website=NCATS Inxight: Drugs}} It binds poorly to the sigma-1 receptor, a receptor activated by many other antitussives.{{cite journal | vauthors = Musacchio JM, Klein M | title = Dextromethorphan binding sites in the guinea pig brain | journal = Cellular and Molecular Neurobiology | volume = 8 | issue = 2 | pages = 149–56 | date = June 1988 | pmid = 3044591 | doi = 10.1007/BF00711241 | s2cid = 33844132 | pmc = 11567495 }} It is reported to have respiratory stimulant activity.{{cite journal | vauthors = Sasaki T, Sugiyama M, Sasaki H, Suzuki S, Takishima T | title = Effects of the antitussive fominoben (PB89) on hypoxia in chronic obstructive lung disease: comparison with dextromethorphan using a double-blind method | journal = The Journal of International Medical Research | volume = 13 | issue = 2 | pages = 96–101 | date = 1985 | pmid = 3158563 | doi = 10.1177/030006058501300204 | s2cid = 30176251 }} Other research has indicated it may be an agonist at the benzodiazepine site of the GABAA receptor.{{cite journal | vauthors = Crawley JN, Blumstein LK, Baldino F | title = Anxiolytic-like properties of fominoben | journal = European Journal of Pharmacology | volume = 97 | issue = 3–4 | pages = 277–81 | date = January 1984 | pmid = 6142823 | doi = 10.1016/0014-2999(84)90460-6 }} It was introduced in Germany in 1973, in Italy in 1979, and in Japan in 1983.{{cite book |author = William Andrew Publishing |title=Pharmaceutical Manufacturing Encyclopedia |url= https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA1103 |date=22 October 2013 |publisher=Elsevier |isbn=978-0-8155-1856-3 |pages=1705–7 }}

Adverse effects include appetite suppression, nausea, vomiting, insomnia, irritability, and hallucinations. Rarer side effects include somnolence, dizziness, dry mouth, blurred vision, and urticaria.{{cite book |isbn=9788448604271|title=Farmacología clínica y terapéutica médica|last1=Martín|first1=Alfonso Velasco|year=2004|chapter=Tratamiento sintomático de la tos y del resfriado común|page=260|publisher=McGraw-Hill/Interamericana }}

References