forchlorfenuron

{{Chembox

| Watchedfields = changed

| verifiedrevid = 443846511

| ImageFile = Forchlorfenuron.svg

| ImageSize =

| ImageAlt =

| PIN = N-(2-Chloropyridin-4-yl)-N′-phenylurea

| OtherNames = N-(2-Chloro-4-pyridyl)-N'-phenylurea; CPPU; 4PU30 cpd

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 68157-60-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K62IP7463J

| PubChem =93379

| SMILES = C1=CC=C(C=C1)NC(=O)NC2=CC(=NC=C2)Cl

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 84301

| ChEBI = 81861

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C12H10ClN3O/c13-11-8-10(6-7-14-11)16-12(17)15-9-4-2-1-3-5-9/h1-8H,(H2,14,15,16,17)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GPXLRLUVLMHHIK-UHFFFAOYSA-N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18604

}}

|Section2={{Chembox Properties

| Formula =C₁₂H₁₀ClN₃O

| MolarMass =247.68 g/mol

| Appearance = White to off-white crystalline powder

| Density = 1.3839 at 25 deg C

| MeltingPt = 165-170 deg C

| BoilingPt =

| Solubility = 39 mg/L (pH 6.4, 21 deg C)

| Solubility1 = 119 g/L

| Solvent1 = methanol

| Solubility2 = 149 g/L

| Solvent2 = ethanol

| Solubility3 = 127 g/L

| Solvent3 = acetone

| Solubility4 = 2.7 g/L

| Solvent4 = chloroform }}{{cite web|url=https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68157-60-8|archive-url=https://web.archive.org/web/20180531031133/https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68157-60-8|url-status=dead|archive-date=2018-05-31|title=TOXNET|website=toxnet.nlm.nih.gov}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Forchlorfenuron is a plant growth regulator.{{Cite web |url=http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=OJ:L:2006:025:0024:0027:EN:PDF |title=Commission Directive 2006/10/EC of 27 January 2006 amending Council Directive 91/414/EEC to include forchlorfenuron and indoxacarb as active substances. Official Journal of the European Union 2006-1-28 |access-date=2011-05-17 |archive-url=https://web.archive.org/web/20121008150355/http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=OJ:L:2006:025:0024:0027:EN:PDF |archive-date=2012-10-08 |url-status=live }} It has been approved for use on kiwifruit and grapes in the United States,{{cite web|url=http://www.epa.gov/opprd001/factsheets/forchlorfenuron.pdf|title=Pesticide Fact Sheet for new chemical: Forchlorfenuron; issued: September 2004. United States Environmental Protection Agency, Office of Prevention, Pesticides and Toxic Substances (7501C)|access-date=2011-05-18|archive-url=https://web.archive.org/web/20110626013952/http://www.epa.gov/opprd001/factsheets/forchlorfenuron.pdf|archive-date=2011-06-26|url-status=live}} and it has been associated with news of watermelons exploding in China.{{Cite web |url=https://www.nbcnews.com/id/wbna43057267 |title=Exploding watermelons! Acres of crops erupt - World news - Weird news - NBC News |website=NBC News |date=17 May 2011 |access-date=2011-05-17 }}