foretinib
{{Chembox
| ImageFile = Foretinib.svg
| ImageSize = 250px
| PIN = N1-[3-Fluoro-4-({6-methoxy-7-[3-(morpholin-4-yl)propoxy]quinolin-4-yl}oxy)phenyl]-N′1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide
| OtherNames = XL880; EXEL-2880; GSK1363089; GSK089
|Section1={{Chembox Identifiers
| CASNo = 849217-64-7
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 42642645
| ChemSpiderID = 24608641
| ChEMBL = 1908393
| ChEBI = 91418
| DrugBank = DB12307
| UNII = 81FH7VK1C4
| KEGG = D09618
| SMILES = COc1cc2c(ccnc2cc1OCCCN3CCOCC3)Oc4ccc(cc4F)NC(=O)C5(CC5)C(=O)Nc6ccc(cc6)F
| InChI = InChI=1S/C34H34F2N4O6/c1-43-30-20-25-27(21-31(30)45-16-2-13-40-14-17-44-18-15-40)37-12-9-28(25)46-29-8-7-24(19-26(29)36)39-33(42)34(10-11-34)32(41)38-23-5-3-22(35)4-6-23/h3-9,12,19-21H,2,10-11,13-18H2,1H3,(H,38,41)(H,39,42)
| StdInChIKey = CXQHYVUVSFXTMY-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=34 | H=34 | F=2 | N=4 | O=6
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Foretinib is an experimental drug candidate for the treatment of cancer.{{cite journal |author1=Hedgethorne, K. |author2=Huang, P.H. | title = Foretinib. c-Met and VEGFR-2 inhibitor, Oncolytic | journal = Drugs of the Future | year = 2010 | volume = 35 | issue = 11 | pages = 893–901 | doi = 10.1358/dof.2010.35.11.1529012}} It was discovered by Exelixis and is under development by GlaxoSmithKline.{{cite web | url = http://www.exelixis.com/pipeline/xl880 | title = XL880 (GSK1363089) | publisher = Exelixis, Inc}} About 10 Phase II clinical trials have been run.{{cite web| url = http://clinicaltrials.gov/ct2/results?term=Foretinib+ | title = Foretinib | publisher = clinicaltrials.gov}} {{As of |2015|10}} it appears development has been discontinued.{{cite web|url=http://adisinsight.springer.com/drugs/800022245|title=Foretinib - AdisInsight|website=adisinsight.springer.com|access-date=16 April 2018}}
Foretinib is an inhibitor of the kinase enzymes c-Met and vascular endothelial growth factor receptor 2 (VEGFR-2).{{cite journal | pmid = 19808973 | year = 2009 | last1 = Qian | first1 = F | last2 = Engst | first2 = S | last3 = Yamaguchi | first3 = K | last4 = Yu | first4 = P | last5 = Won | first5 = KA | last6 = Mock | first6 = L | last7 = Lou | first7 = T | last8 = Tan | first8 = J | last9 = Li | first9 = C | last10 = Tam | first10 = D. | last11 = Lougheed | first11 = J. | last12 = Yakes | first12 = F. M. | last13 = Bentzien | first13 = F. | last14 = Xu | first14 = W. | last15 = Zaks | first15 = T. | last16 = Wooster | first16 = R. | last17 = Greshock | first17 = J. | last18 = Joly | first18 = A. H. | title = Inhibition of tumor cell growth, invasion, and metastasis by EXEL-2880 (XL880, GSK1363089), a novel inhibitor of HGF and VEGF receptor tyrosine kinases | volume = 69 | issue = 20 | pages = 8009–16 | doi = 10.1158/0008-5472.CAN-08-4889 | journal = Cancer Research| display-authors = 8 }}
See also
- c-Met inhibitors
- Cabozantinib, a similar molecule and kinase inhibitor with FDA approval
- VEGFR inhibitor
- tyrosine-kinase inhibitor
References
{{Reflist}}
{{Growth factor receptor modulators}}
Category:Tyrosine kinase inhibitors
Category:4-Morpholinyl compounds