formocortal

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447610062

| IUPAC_name = 2-[(1S,2S,4R,8S,9S,11S,12R,13S)-16-(2-chloroethoxy)-12-fluoro-19-formyl-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.0^2,9.0^4,8.0^13,18]icosa-16,18-dien-8-yl]-2-oxoethyl acetate

| image = Formocortal.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2825-60-7

| ATC_prefix = S01

| ATC_suffix = BA12

| PubChem = 17794

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 254985

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13664

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8E21R0Z4M5

| KEGG = D04244

| synonyms = 3-(2-chloroethoxy)-6-formyl-9α-fluoropregna-3,5-diene-11β,16α,17,21-tetrol-20-one 21-acetate

| C=29 | H=38 | Cl=1 | F=1 | O=8

| smiles = CC(=O)OCC(=O)[C@@]12[C@@H](C[C@@H]3[C@@]1(C[C@@H]([C@]4([C@H]3CC(=C5[C@@]4(CCC(=C5)OCCCl)C)C=O)F)O)C)OC(O2)(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C29H38ClFO8/c1-16(33)37-15-23(35)29-24(38-25(2,3)39-29)12-20-21-10-17(14-32)19-11-18(36-9-8-30)6-7-26(19,4)28(21,31)22(34)13-27(20,29)5/h11,14,20-22,24,34H,6-10,12-13,15H2,1-5H3/t20-,21-,22-,24+,26-,27-,28-,29+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QNXUUBBKHBYRFW-QWAPGEGQSA-N

}}

Formocortal (INN), also known as fluoroformylone, is a corticosteroid used in dermatology{{cite journal | vauthors = Aliperta G, Lattaro R | title = [On the topical use of a new steroid, formocortal, in the treatment of phlebodermitis and in cutaneous auto- and homo-grafts] | journal = Minerva Cardioangiologica | volume = 19 | issue = 11 | pages = 620–624 | date = November 1971 | pmid = 4942789 }} and ophthalmology.{{cite journal | vauthors = Marchese A, Bozzolasco M, Gualco L, Schito GC, Debbia EA | title = Evaluation of spontaneous contamination of ocular medications | journal = Chemotherapy | volume = 47 | issue = 4 | pages = 304–308 | year = 2001 | pmid = 11399868 | doi = 10.1159/000048538 | s2cid = 33870589 }}

It was introduced in around 1970 and is not known to be marketed {{as of|2021|lc=on}}.