fragilin

{{Chembox

| ImageFile = Fragilin.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 2-Chloro-1,8-dihydroxy-3-methoxy-6-methylanthracene-9,10-dione

| OtherNames = 2-Chlorophyscion

| Section1 = {{Chembox Identifiers

| CASNo = 2026-19-9

| ChEBI = 144155

| ChemSpiderID = 28288961

| PubChem = 15559331

| UNII = 5FI0O7S06V

| SMILES = CC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)OC)Cl)O

| InChI = 1S/C16H11ClO5/c1-6-3-7-11(9(18)4-6)15(20)12-8(14(7)19)5-10(22-2)13(17)16(12)21/h3-5,18,21H,1-2H3

| InChIKey = RTBAOFRCWWQFHB-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C = 16| H = 11 | Cl = 1 | O = 5

| Appearance =

| Density =

| MeltingPtC = 267-268

| MeltingPt_ref = {{cite journal | doi = 10.3891/acta.chem.scand.19-0839 | title = The Constitution of Fragilin | date = 1965 | last1 = Bruun | first1 = Torger | last2 = Hollis | first2 = Donald P. | last3 = Ryhage | first3 = Ragnar | last4 = Nielsen | first4 = P. H. | last5 = Sjöberg | first5 = Berndt | last6 = Larsen | first6 = Erik | journal = Acta Chemica Scandinavica | volume = 19 | pages = 839–844 }}

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Fragilin is a chemical compound of the anthraquinone class. It has the molecular formula {{chem2|C16H11ClO5}} and is a chlorinated derivative of parietin. In 1965, it was reported as a constituent of the lichens Sphaerophorus fragilis and Sphaerophorus coralloides. It has since been found in a variety of other lichens including Nephroma laevigatum,{{cite journal | doi = 10.3891/acta.chem.scand.21-2889 | title = Chemical Studies on Lichens. 9. Chlorinated Anthraquinones from Nephroma laevigatum | date = 1967 | last1 = Bendz | first1 = Gerd | last2 = Bohman | first2 = Gerd | last3 = Santesson | first3 = Johan | last4 = Cyvin | first4 = S. J. | last5 = Hagen | first5 = G. | journal = Acta Chemica Scandinavica | volume = 21 | pages = 2889–2890 }} Caloplaca,{{cite journal | doi = 10.1016/s0031-9422(00)85978-6 | title = Anthraquinones from the genus Caloplaca | date = 1969 | last1 = Bohman | first1 = Gerd | journal = Phytochemistry | volume = 8 | issue = 9 | pages = 1829–1830 | bibcode = 1969PChem...8.1829B }} Xanthoria parietina,{{cite journal | doi = 10.1039/J39700000307 | title = The minor anthraquinones of Xanthoria parietina(L.) Beltram, the chlorination of parietin, and the synthesis of fragilin and 7-chloroemodin ('AO-1') | date = 1970 | last1 = Sargent | first1 = M. V. | last2 = Smith | first2 = David O'N. | last3 = Elix | first3 = J. A. | journal = J. Chem. Soc. C | issue = 2 | pages = 307–311 }} and others.