friedelin

{{Chembox

| ImageFile = Friedelin.svg

| ImageAlt =

| SystematicName = (4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethylicosahydropicen-3(2H)-one

| OtherNames = Friedeline; Friedelan-3-one

|Section1={{Chembox Identifiers

| CASNo = 559-74-0

| CASNo_Ref = {{cascite|correct|CAS}}

| ChEBI = 5171

| ChEMBL = 485998

| ChemSpiderID = 82597

| EC_number = 209-205-1

| KEGG = C08626

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AK21264UAD

| PubChem = 91472

| SMILES = C[C@H]1C(=O)CC[C@@H]2[C@@]1(CC[C@H]3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C)C)C)C)C

| StdInChI=1S/C30H50O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h20,22-24H,9-19H2,1-8H3/t20-,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1

| StdInChIKey = OFMXGFHWLZPCFL-SVRPQWSVSA-N

}}

|Section2={{Chembox Properties

| C=30 | H=50 | O=1

| Appearance = white powder

| Density = 0.693 g/cm³

| MeltingPtC = 263

| BoilingPtC = 477.18

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt = 233.9 °C

| AutoignitionPt = }}

}}

Friedelin is a triterpenoid chemical compound found in Azima tetracantha, Orostachys japonica,{{cite book|title=Medicinal Plants In the Republic of Korea|publisher=Natural Products research institute (Seoul National University)|pages=187}} and Quercus stenophylla.{{Cite journal|pages= 1244–1245|pmid=5751298|language=Japanese|year= 1968|last1= Onishi|first1= Y|last2= Hanaoka|first2= M|title= Studies on the chemical components of Quercus stenophylla Makino. I. Isolation of friedelin from the leaves of Quercus stenophylla Makino|volume= 88|issue= 9|journal= Yakugaku Zasshi|doi=10.1248/yakushi1947.88.9_1244|doi-access= free}} Friedelin is also found in the roots of the Cannabis plant.{{Cite book|doi=10.1016/bs.apha.2017.03.004|issn=1054-3589 |title = Cannabinoid Pharmacology |volume=80 |pages=67–134|series = Advances in Pharmacology |year = 2017|last1 = Russo|first1 = Ethan B|last2=Marcu|first2=Jahan|chapter=Cannabis Pharmacology: The Usual Suspects and a Few Promising Leads |pmid=28826544 |isbn=9780128112328}}