frovatriptan

{{Short description|Chemical compound}}

{{Use dmy dates|date=April 2025}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461114004

| image = Frovatriptan structure.svg

| alt =

| image2 = Frovatriptan 3D BS.png

| alt2 =

| pronounce =

| tradename = Frova

| Drugs.com = {{drugs.com|monograph|frova}}

| MedlinePlus = a604013

| DailyMedID = Frovatriptan

| pregnancy_AU = B3

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Oral

| class =

| ATC_prefix = N02

| ATC_suffix = CC07

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability = 20–30%

| protein_bound =

| metabolism = Liver

| metabolites =

| onset =

| elimination_half-life = 26 hours

| duration_of_action =

| excretion = Kidney

| index2_label = succinate

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 158747-02-5

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 158930-17-7

| PubChem = 77992

| IUPHAR_ligand = 7191

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00998

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 70378

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = H82Q2D5WA7

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = D28J6W18HY

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D07997

| ChEBI =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1279

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 6-methylamino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide
(6R)-6-methylamino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide

| IUPAC_name = (+)-(R)-3-Methylamino-6-carboxamido-1,2,3,4-tetrahydrocarbazole

| C=14 | H=17 | N=3 | O=1

| SMILES = CN[C@@H]3CCc2[nH]c1ccc(C(N)=O)cc1c2C3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H17N3O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18)/t9-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XPSQPHWEGNHMSK-SECBINFHSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Frovatriptan, sold under the brand name Frova, is a triptan medication developed by Vernalis for the treatment of migraine headaches{{cite journal | vauthors = Allais G, Benedetto C | title = Spotlight on frovatriptan: a review of its efficacy in the treatment of migraine | journal = Drug Design, Development and Therapy | volume = 10 | issue = | pages = 3225–3236 | date = 2016 | pmid = 27757013 | pmc = 5055118 | doi = 10.2147/DDDT.S105932 | doi-access = free }} and for short term prevention of menstrual migraine.{{cite journal | vauthors = MacGregor EA | title = A review of frovatriptan for the treatment of menstrual migraine | journal = International Journal of Women's Health | volume = 6 | issue = | pages = 523–35 | date = 2014 | pmid = 24904224 | pmc = 4039425 | doi = 10.2147/IJWH.S63444 | doi-access = free }} The product is licensed to Endo Pharmaceuticals in North America and Menarini in Europe.{{cite web|title=Frova |url=http://www.vernalis.com/ver/rdc2/pain/frovatriptan/ |publisher=Vernalis |access-date=2007-11-28 |archive-url=https://web.archive.org/web/20070927225521/http://www.vernalis.com/ver/rdc2/pain/frovatriptan/ |archive-date=2007-09-27 |url-status=dead }}

Medical uses

Frovatriptan is used in the treatment of migraine.

=Available forms=

It is available as 2.5 mg tablets.

Contraindications

Frovatriptan should not be given to patients with:

  • Ischemic heart disease
  • Cerebrovascular syndrome
  • Peripheral vascular disease
  • Uncontrolled hypertension
  • Hemiplegic or basilar migraine

Side effects

Rare, but serious cardiac events have been reported in patients with risk factors predictive of CAD. These include: coronary artery vasospasm, transient myocardial ischemia, myocardial infarction, ventricular tachycardia and ventricular fibrillation.

Pharmacology

=Pharmacodynamics=

{{Further|Serotonin receptor agonist|Triptan#Mechanism_of_action}}

Frovatriptan is a serotonin receptor agonist, with high affinity for the 5-HT1B/1D receptors. It has no significant effects on the GABAA mediated channel activity and benzodiazepine binding sites. Frovatriptan inhibits excessive dilation of arteries that supply blood to the head.

=Pharmacokinetics=

Frovatriptan has a terminal elimination half-life of approximately 26 hours, making it the longest within its class.{{Cite journal|last=Balbisi|first=Ebrahim|date=September 2006|title=Frovatriptan: A Review of Pharmacology, Pharmacokinetics and Clinical Potential in the Treatment of Menstrual Migraine|journal=Therapeutics and Clinical Risk Management|volume=2|issue=3|pages=303–308|doi=10.2147/tcrm.2006.2.3.303|pmid=18360605|pmc=1936266 |doi-access=free }}

Society and culture

=Legal status=

Frovatriptan is available only by prescription in the United States and Canada.{{cite web|title=Patient Information Sheet -- Frovatriptan succinate (marketed as Frova) |url=https://www.fda.gov/cder/drug/InfoSheets/patient/frovatripanPIS.htm |date=July 2006 |publisher=Food and Drug Administration |access-date=2007-11-28 |archive-url=https://web.archive.org/web/20070929141557/https://www.fda.gov/cder/drug/InfoSheets/patient/frovatripanPIS.htm |archive-date=2007-09-29 |url-status=dead }}

References

{{Reflist}}

{{Antimigraine preparations}}

{{Serotonin receptor modulators}}

{{Tryptamines}}

{{Portal bar | Medicine}}

{{Authority control}}

Category:5-HT1B agonists

Category:5-HT1D agonists

Category:5-HT7 agonists

Category:Secondary amines

Category:Carbazoles

Category:Carboxamides

Category:N-Monoalkyltryptamines

Category:Triptans