funapide

{{Short description|Analgesic drug under development}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (7S)-1'-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one

| image = Funapide.svg

| image_class = skin-invert-image

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth, topical

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1259933-16-8

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 49836093

| DrugBank_Ref =

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A5595LHJ2L

| KEGG = D11156

| ChemSpiderID_Ref =

| ChemSpiderID = 34500834

| C=22 | H=14 | F=3 | N=1 | O=5

| smiles = C1C2(C3=CC=CC=C3N(C2=O)CC4=CC=C(O4)C(F)(F)F)C5=CC6=C(C=C5O1)OCO6

| StdInChI = 1S/C22H14F3NO5/c23-22(24,25)19-6-5-12(31-19)9-26-15-4-2-1-3-13(15)21(20(26)27)10-28-16-8-18-17(7-14(16)21)29-11-30-18/h1-8H,9-11H2/t21-/m0/s1

| StdInChIKey = NEBUOXBYNAHKFV-NRFANRHFSA-N

| synonyms =

}}

Funapide (INN; former developmental codes TV-45070 and XEN402) is a novel analgesic under development by Xenon Pharmaceuticals (formerly in partnership with Teva Pharmaceutical Industries) for the treatment of a variety of chronic pain conditions, including osteoarthritis, neuropathic pain, postherpetic neuralgia, and erythromelalgia, as well as dental pain.{{cite journal | vauthors = Bagal SK, Chapman ML, Marron BE, Prime R, Storer RI, Swain NA | title = Recent progress in sodium channel modulators for pain | journal = Bioorganic & Medicinal Chemistry Letters | volume = 24 | issue = 16 | pages = 3690–3699 | date = August 2014 | pmid = 25060923 | doi = 10.1016/j.bmcl.2014.06.038 | doi-access = free }}{{cite book | vauthors = Ali Z, Palmer JE, Goli V | chapter = Anticonvulsants: Clinical | veditors = McMahon S, Koltzenburg M, Tracey I, Turk DC |author3-link=Irene Tracey | date = 2013 | title = Wall & Melzack's Textbook of Pain| edition = 6 | publisher = Elsevier Health Sciences | page = 508 | isbn = 978-0-7020-4059-7 | oclc = 1008841684 | url = https://books.google.com/books?id=bNlvQJSqrB8C&q=XEN402 }}{{cite web | url = http://www.xenon-pharma.com/product-candidates/pain/pain-teva/ | archive-url = https://web.archive.org/web/20130715014056/http://www.xenon-pharma.com/product-candidates/pain/pain-teva/ | archive-date = 15 July 2013 | title = TV-45070: A Small Molecule for the Treatment of the Orphan Disease EM and Other Pain Disorders | work = Xenon Pharma}}{{cite web | url = http://www.xenon-pharma.com/2012/12/teva-and-xenon/ | title = Teva and Xenon Announce Teva's World Wide License of Xenon's Pain Drug XEN402 | date = 11 December 2012 | work = Xenon Pharma | access-date = 2014-07-20 | archive-url = https://web.archive.org/web/20140726121541/http://www.xenon-pharma.com/2012/12/teva-and-xenon/ | archive-date = 26 July 2014 | url-status = dead }} It acts as a small-molecule Na_v1.7 and Na_v1.8 voltage-gated sodium channel blocker. Funapide was evaluated in humans in both oral and topical formulations, and as of July 2014, had reached phase IIb clinical trials. Development of the drug was discontinued in 2022.{{cite web | url = http://adisinsight.springer.com/drugs/800025125 | title = Funapide - Flexion Therapeutics | work = AdisInsight | publisher = Springer Nature Switzerland AG }}