gabexate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449581249

| IUPAC_name = ethyl 4-[6-(diaminomethylideneamino)hexanoyloxy]benzoate

| image = Gabexate.svg

| width = 250

| tradename =

| Drugs.com = {{drugs.com|international|gabexate}}

| legal_UK =

| legal_US =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7863

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 39492-01-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3447

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 87563

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4V7M9137X9

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08004

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3329

| smiles = O=C(Oc1ccc(cc1)C(=O)OCC)CCCCC/N=C(\N)N

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H23N3O4/c1-2-22-15(21)12-7-9-13(10-8-12)23-14(20)6-4-3-5-11-19-16(17)18/h7-10H,2-6,11H2,1H3,(H4,17,18,19)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YKGYIDJEEQRWQH-UHFFFAOYSA-N

| C=16 | H=23 | N=3 | O=4

| density =

}}

Gabexate is a serine protease inhibitor which is used therapeutically (as gabexate mesilate) in the treatment of pancreatitis, disseminated intravascular coagulation,{{cite journal |vauthors=Yuksel M, Okajima K, Uchiba M, Okabe H |title=Gabexate mesilate, a synthetic protease inhibitor, inhibits lipopolysaccharide-induced tumor necrosis factor-alpha production by inhibiting activation of both nuclear factor-kappaB and activator protein-1 in human monocytes |journal=J. Pharmacol. Exp. Ther. |volume=305 |issue=1 |pages=298–305 |year=2003 |pmid=12649382 |doi=10.1124/jpet.102.041988 |s2cid=23518949 }} and as a regional anticoagulant for haemodialysis.{{cite journal |vauthors=Cavallini G, Tittobello A, Frulloni L, Masci E, Mariana A, Di Francesco V |title=Gabexate for the prevention of pancreatic damage related to endoscopic retrograde cholangiopancreatography. Gabexate in digestive endoscopy--Italian Group |journal=N. Engl. J. Med. |volume=335 |issue=13 |pages=919–23 |year=1996 |pmid=8786777 |doi= 10.1056/NEJM199609263351302|doi-access=free }}