galactitol

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443831933

| ImageFile=Dulcitol.svg

| ImageFile2=D-Galactitol.png

| ImageSize=

| IUPACName=D-Galactitol

|SystematicName=(2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol

| OtherNames=Dulcitol

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 11357

| InChI = 1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-

| InChIKey = FBPFZTCFMRRESA-GUCUJZIJBM

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6-

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FBPFZTCFMRRESA-GUCUJZIJSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=608-66-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 113ZQ1Y7DD

| PubChem=11850

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1773904

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16813

| SMILES = O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)CO

}}

|Section2={{Chembox Properties

| C=6 | H=14 | O=6

| MolarMass=182.172 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

| MagSus = −112.40·10⁻⁶ cm³/mol

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Galactitol (dulcitol) is a sugar alcohol, the reduction product of galactose.{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11850|title=Galactitol - Compound Summary |publisher=National Center for Biotechnology Information|access-date=2008-08-06}} It has a slightly sweet taste. In people with galactokinase deficiency, a form of galactosemia, excess dulcitol forms in the lens of the eye leading to cataracts.{{cite web |url = http://www.emedicine.com/ped/TOPIC815.HTM |title = Galactokinase Deficiency |access-date = 2008-08-08 |author = Roth, KS |date = September 10, 2007 |work = eMedicine |publisher = WebMD}}

Galactitol is produced from galactose in a reaction catalyzed by aldose reductase.

The other common galactose metabolism defect is a defect in galactose-1-phosphate uridylyltransferase, an autosomal recessive disorder, which also causes a buildup of galactitol as a result of increased concentrations of galactose-1-phosphate and galactose. This disorder leads to cataracts caused by galactitol buildup.