gamithromycin

{{Short description|Medication}}

{{Use American English|date=June 2024}}

{{Use dmy dates|date=June 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Gamithromycin.svg

| width =

| alt =

| caption =

| pronounce =

| tradename = Zactran

| Drugs.com =

| MedlinePlus =

| DailyMedID = Gamithromycin

| pregnancy_AU =

| pregnancy_AU_comment =

| routes_of_administration = Subcutaneous

| class = Macrolide antibiotic

| ATCvet = Yes

| ATC_prefix = J01

| ATC_suffix = FA95

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Zactran - gamithromycin injection, solution | website=DailyMed | date=17 April 2024 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=4ad34f81-65e1-4858-8928-50af8bcb3db9 | access-date=29 June 2024}}{{cite web | title=Zactran | website=U.S. Food and Drug Administration (FDA) | url=https://animaldrugsatfda.fda.gov/adafda/views/#/home/previewsearch/141-328 | access-date=29 June 2024}}

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title=Zactran EPAR | website=European Medicines Agency | date=1 August 2008 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/zactran | access-date=29 June 2024}}{{cite web | title=Zactran PI | website=Union Register of veterinary medicinal products | date=28 July 2008 | url=https://ec.europa.eu/health/documents/community-register/html/v082.htm | access-date=29 June 2024}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 145435-72-9

| CAS_supplemental =

| PubChem = 59364992

| IUPHAR_ligand =

| DrugBank = DB11416

| ChemSpiderID = 28530824

| UNII = ZE856183S0

| KEGG = D06598

| ChEBI = 195437

| ChEMBL = 2107342

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = ML-1709460, ML-460

| IUPAC_name = (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-11-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy}-2-ethyl-3,4,10-trihydroxy-13-{[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy}-3,5,8,10,12,14-hexamethyl-7-propyl-1-oxa-7-azacyclopentadecan-15-one

| C = 40 | H = 76 | N = 2 | O = 12

| SMILES = [H][C@@]1(C[C@@](C)(OC)[C@@H](O)[C@H](C)O1)O[C@H]1[C@H](C)[C@@H](O[C@]2([H])O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)N(CCC)C[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C

| StdInChI = 1S/C40H76N2O12/c1-15-17-42-21-22(3)33(44)40(11,48)29(16-2)52-36(46)26(7)32(53-30-20-39(10,49-14)34(45)27(8)51-30)25(6)35(38(9,47)19-23(42)4)54-37-31(43)28(41(12)13)18-24(5)50-37/h22-35,37,43-45,47-48H,15-21H2,1-14H3/t22-,23+,24+,25-,26+,27-,28-,29+,30-,31+,32-,33+,34-,35+,37-,38+,39+,40+/m0/s1

| StdInChI_comment =

| StdInChIKey = VWAMTBXLZPEDQO-UZSBJOJWSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Gamithromycin, sold under the brand name Zactran, is a veterinary medication used for the treatment of cattle, pigs, and sheep.{{cite book | vauthors = Budde JA, McCluskey DM | chapter = Gamithromycin |title=Plumb's Veterinary Drug Handbook |date=2023 |publisher=Educational Concepts, LLC, dba VetMedux |location=Tulsa, OK |isbn=978-1-394-17220-7 |pages=571 |edition=10th | chapter-url = https://books.google.com/books?id=D9a5EAAAQBAJ&dq=Gamithromycin&pg=PA571}} It is a azalide antibacterial related to azithromycin.{{cite web | title=Gamithromycin | website=Inxight Drugs | url=https://drugs.ncats.io/substance/ZE856183S0 | access-date=29 June 2024}} {{PD-notice}}

It was approved for veterinary use in the European Union in 2008.

Veterinary uses

In the EU, gamithromycin is indicated for the treatment and prevention of bovine respiratory disease in cattle, swine respiratory disease in pigs, and infectious pododermatitis (foot rot) in sheep.

In the US, gamithromycin is indicated for the treatment of bovine respiratory disease in cattle.

References

{{reflist}}