geissolosimine

{{Chembox

| ImageFile = Geissolosimine.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = (1R,12S,14S)-14-ethyl-9-[(14S,15E)-15-ethylidene-3,17-diazapentacyclo[12.3.1.0^2,10.0^4,9.0^12,17]octadeca-2(10),4,6,8-tetraen-13-yl]-10-oxa-8,16-diazahexacyclo[11.5.2.11,8.0^2,7.0^16,19.0^12,21]henicosa-2,4,6-triene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 7096-95-9

| CASNo_Ref = {{Cascite|changed|??}}

| ChEBI = 141903

| ChEMBL = 4062854

| ChemSpiderID = 34532525

| PubChem = 71594126

| StdInChI=1S/C38H44N4O/c1-3-21-18-40-14-13-38-28-10-6-8-12-30(28)42-36(38)27(24(21)17-33(38)40)20-43-37(42)34-25-15-32-35-26(23-9-5-7-11-29(23)39-35)16-31(34)41(32)19-22(25)4-2/h4-12,21,24-25,27,31-34,36-37,39H,3,13-20H2,1-2H3/b22-4-/t21-,24?,25-,27+,31?,32?,33?,34?,36?,37?,38-/m1/s1

| StdInChIKey = CSVWQRLFFUNUND-KJSNTNJZSA-N

| SMILES = CC[C@@H]1CN2CC[C@@]34C2CC1[C@H]5C3N(C(OC5)C6[C@@H]\7CC8C9=C(CC6N8C/C7=C/C)C1=CC=CC=C1N9)C1=CC=CC=C41

}}

|Section2={{Chembox Properties

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section8 = {{Chembox Related

| OtherCompounds = Divaricine

}}

}}

Geissolosimine is an antiplasmodial indole alkaloid isolated from the bark of Geissospermum vellosii.{{cite journal | last=Mbeunkui | first=Flaubert | last2=Grace | first2=Mary H. | last3=Lategan | first3=Carmen | last4=Smith | first4=Peter J. | last5=Raskin | first5=Ilya | last6=Lila | first6=Mary Ann | title=In vitro antiplasmodial activity of indole alkaloids from the stem bark of Geissospermum vellosii | journal=Journal of Ethnopharmacology | publisher=Elsevier BV | volume=139 | issue=2 | year=2012 | issn=0378-8741 | doi=10.1016/j.jep.2011.11.036 | pmid = 22143154 | pages = 471–477}}