glafenine

{{Short description|Chemical compound}}

{{Drugbox

| drug_name =

| IUPAC_name = 2,3-Dihydroxypropyl 2-[(7-chloro-4-quinolinyl)amino]benzoate

| image = Glafenine.svg

| image_class = skin-invert-image

| width = 180

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 3820-67-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 46HL4I09AH

| ATCvet =

| ATC_prefix = N02

| ATC_suffix = BG03

| PubChem = 3474

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 31653

| ChEMBL = 146095

| DrugBank =

| ChemSpiderID = 3355

| C=19 | H=17 | Cl=1 | N=2 | O=4

| smiles = O=C(OCC(O)CO)c1ccccc1Nc2c3ccc(Cl)cc3ncc2

| StdInChI = 1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22)

| StdInChIKey = GWOFUCIGLDBNKM-UHFFFAOYSA-N

| melting_point = 169

| melting_high = 170

}}

Glafenine is a nonsteroidal anti-inflammatory drug (NSAID). Use of glafenine is limited due to the risk of anaphylaxis and acute kidney failure.{{Cite journal | doi = 10.1016/0140-6736(92)91670-4 | title = Withdrawal of glafenine | year = 1992 | journal = The Lancet | volume = 339 | issue = 8789 | pages = 357| s2cid = 54255503 }}{{cite journal | vauthors = Kleinknecht D, Landais P, Goldfarb B | title = Analgesic and non-steroidal anti-inflammatory drug-associated acute renal failure: a prospective collaborative study | journal = Clinical Nephrology | volume = 25 | issue = 6 | pages = 275–81 | date = June 1986 | pmid = 2873910 }}