glicaramide

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-ethyl-3-methyl-4-(3-methylbutoxy)pyrazolo[3,4-b]pyridine-5-carboxamide

| image = Glicaramide.svg

| width = 275

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 36980-34-4

| ATC_prefix = None

| ATC_suffix =

| PubChem = 65799

| ChEMBL = 2106430

| ChemSpiderID = 59215

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UK5SR22C8Q

| C=30 | H=42 | N=6 | O=5 | S=1

| SMILES = C0CCCCC0NC(=O)NS(=O)(=O)c1ccc(cc1)CCNC(=O)c2cnc3n(CC)nc(C)c3c2OCCC(C)C

}}

Glicaramide (SQ-65993) is an orally bioavailable anti-diabetic medication.{{cite journal | vauthors = Höhn H, Polacek I, Schulze E | title = Potential antidiabetic agents. Pyrazolo(3,4-b)pyridines | journal = Journal of Medicinal Chemistry | volume = 16 | issue = 12 | pages = 1340–6 | date = December 1973 | pmid = 4358224 | doi = 10.1021/jm00270a006 }} It has a similar potency as glibenclamide (glyburide) in the class of medication known as sulfonylureas. Its structure is similar since it has a cyclic acyl group which replaces the latter's 2-methoxy-5-chlorobenzyl.{{cite book | vauthors = Sarges R | chapter = Hypoglycemic Drugs | veditors = Ellis GP, West GB | title = Progress in Medicinal Chemistry | date = 1981 | volume = 18 | chapter-url = https://books.google.com/books?id=FC9pDtB_tz0C&pg=PA202 | pages = 202 | publisher = Elsevier Science | isbn = 0-444-80345-9 | access-date = 2016-10-18 | archive-date = 2023-01-28 | archive-url = https://web.archive.org/web/20230128020246/https://books.google.com/books?id=FC9pDtB_tz0C&pg=PA202 | url-status = live }} Same as glibenclamide, it is classified as a second-generation sulfonylurea. It may have more pronounced extra-pancreatic effects than glibenclamide or tolbutamide.